About diethyl (2Z,4E)-2-hydroxy-5-phenylsulfanylhexa-2,4-dienedioate
diethyl (2Z,4E)-2-hydroxy-5-phenylsulfanylhexa-2,4-dienedioate (PubChem CID 54733807) has the molecular formula C16H18O5S
and a molecular weight of 322.38 g/mol. Its IUPAC name is diethyl (2Z,4E)-2-hydroxy-5-phenylsulfanylhexa-2,4-dienedioate.
Molecular Properties
| Compound Name | diethyl (2Z,4E)-2-hydroxy-5-phenylsulfanylhexa-2,4-dienedioate |
| PubChem CID | 54733807 |
| Molecular Formula | C16H18O5S |
| Molecular Weight | 322.38 g/mol |
| Exact Mass | 322.09 |
| IUPAC Name | diethyl (2Z,4E)-2-hydroxy-5-phenylsulfanylhexa-2,4-dienedioate |
| SMILES | CCOC(=O)/C(O)=C/C=C(/Sc1ccccc1)C(=O)OCC |
| InChI | InChI=1S/C16H18O5S/c1-3-20-15(18)13(17)10-11-14(16(19)21-4-2)22-12-8-6-5-7-9-12/h5-11,17H,3-4H2,1-2H3/b13-10-,14-11+ |
| InChIKey | SIKJUMSIIZVHDS-FXYWYECCSA-N |
| XLogP | 3.23 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 322.38 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze diethyl (2Z,4E)-2-hydroxy-5-phenylsulfanylhexa-2,4-dienedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of diethyl (2Z,4E)-2-hydroxy-5-phenylsulfanylhexa-2,4-dienedioate?
The IUPAC name of diethyl (2Z,4E)-2-hydroxy-5-phenylsulfanylhexa-2,4-dienedioate (CID 54733807) is diethyl (2Z,4E)-2-hydroxy-5-phenylsulfanylhexa-2,4-dienedioate.
What is the SMILES notation for diethyl (2Z,4E)-2-hydroxy-5-phenylsulfanylhexa-2,4-dienedioate?
The canonical SMILES for diethyl (2Z,4E)-2-hydroxy-5-phenylsulfanylhexa-2,4-dienedioate is CCOC(=O)/C(O)=C/C=C(/Sc1ccccc1)C(=O)OCC.
What is the InChIKey of diethyl (2Z,4E)-2-hydroxy-5-phenylsulfanylhexa-2,4-dienedioate?
The InChIKey is SIKJUMSIIZVHDS-FXYWYECCSA-N. The full InChI is InChI=1S/C16H18O5S/c1-3-20-15(18)13(17)10-11-14(16(19)21-4-2)22-12-8-6-5-7-9-12/h5-11,17H,3-4H2,1-2H3/b13-10-,14-11+.
What are the key properties of diethyl (2Z,4E)-2-hydroxy-5-phenylsulfanylhexa-2,4-dienedioate?
diethyl (2Z,4E)-2-hydroxy-5-phenylsulfanylhexa-2,4-dienedioate has a molecular weight of 322.38 g/mol, XLogP of 3.23, 7 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for diethyl (2Z,4E)-2-hydroxy-5-phenylsulfanylhexa-2,4-dienedioate is sourced from PubChem (CID 54733807), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).