About diethyl (2Z,4Z)-2-hydroxy-5-phenylhexa-2,4-dienedioate
diethyl (2Z,4Z)-2-hydroxy-5-phenylhexa-2,4-dienedioate (PubChem CID 54733809) has the molecular formula C16H18O5
and a molecular weight of 290.32 g/mol. Its IUPAC name is diethyl (2Z,4Z)-2-hydroxy-5-phenylhexa-2,4-dienedioate.
Molecular Properties
| Compound Name | diethyl (2Z,4Z)-2-hydroxy-5-phenylhexa-2,4-dienedioate |
| PubChem CID | 54733809 |
| Molecular Formula | C16H18O5 |
| Molecular Weight | 290.32 g/mol |
| Exact Mass | 290.12 |
| IUPAC Name | diethyl (2Z,4Z)-2-hydroxy-5-phenylhexa-2,4-dienedioate |
| SMILES | CCOC(=O)/C(O)=C/C=C(\C(=O)OCC)c1ccccc1 |
| InChI | InChI=1S/C16H18O5/c1-3-20-15(18)13(12-8-6-5-7-9-12)10-11-14(17)16(19)21-4-2/h5-11,17H,3-4H2,1-2H3/b13-10-,14-11- |
| InChIKey | SFAVAJPVGQYAKV-WGYBXSNTSA-N |
| XLogP | 2.64 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 290.32 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze diethyl (2Z,4Z)-2-hydroxy-5-phenylhexa-2,4-dienedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of diethyl (2Z,4Z)-2-hydroxy-5-phenylhexa-2,4-dienedioate?
The IUPAC name of diethyl (2Z,4Z)-2-hydroxy-5-phenylhexa-2,4-dienedioate (CID 54733809) is diethyl (2Z,4Z)-2-hydroxy-5-phenylhexa-2,4-dienedioate.
What is the SMILES notation for diethyl (2Z,4Z)-2-hydroxy-5-phenylhexa-2,4-dienedioate?
The canonical SMILES for diethyl (2Z,4Z)-2-hydroxy-5-phenylhexa-2,4-dienedioate is CCOC(=O)/C(O)=C/C=C(\C(=O)OCC)c1ccccc1.
What is the InChIKey of diethyl (2Z,4Z)-2-hydroxy-5-phenylhexa-2,4-dienedioate?
The InChIKey is SFAVAJPVGQYAKV-WGYBXSNTSA-N. The full InChI is InChI=1S/C16H18O5/c1-3-20-15(18)13(12-8-6-5-7-9-12)10-11-14(17)16(19)21-4-2/h5-11,17H,3-4H2,1-2H3/b13-10-,14-11-.
What are the key properties of diethyl (2Z,4Z)-2-hydroxy-5-phenylhexa-2,4-dienedioate?
diethyl (2Z,4Z)-2-hydroxy-5-phenylhexa-2,4-dienedioate has a molecular weight of 290.32 g/mol, XLogP of 2.64, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for diethyl (2Z,4Z)-2-hydroxy-5-phenylhexa-2,4-dienedioate is sourced from PubChem (CID 54733809), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).