C22H24BrNO4 — CID 54733846
ethyl 1-(2-bromo-1-hydroxyethyl)-4-hydroxy-2,6-diphenyl-3,6-dihydro-2H-pyridine-5-carboxylate (PubChem CID 54733846) has the molecular formula C22H24BrNO4 and a molecular weight of 446.34 g/mol. Its IUPAC name is ethyl 1-(2-bromo-1-hydroxyethyl)-4-hydroxy-2,6-diphenyl-3,6-dihydro-2H-pyridine-5-carboxylate.
| Compound Name | ethyl 1-(2-bromo-1-hydroxyethyl)-4-hydroxy-2,6-diphenyl-3,6-dihydro-2H-pyridine-5-carboxylate |
|---|---|
| PubChem CID | 54733846 |
| Molecular Formula | C22H24BrNO4 |
| Molecular Weight | 446.34 g/mol |
| Exact Mass | 445.09 |
| IUPAC Name | ethyl 1-(2-bromo-1-hydroxyethyl)-4-hydroxy-2,6-diphenyl-3,6-dihydro-2H-pyridine-5-carboxylate |
| SMILES | CCOC(=O)C1=C(O)CC(c2ccccc2)N(C(O)CBr)C1c1ccccc1 |
| InChI | InChI=1S/C22H24BrNO4/c1-2-28-22(27)20-18(25)13-17(15-9-5-3-6-10-15)24(19(26)14-23)21(20)16-11-7-4-8-12-16/h3-12,17,19,21,25-26H,2,13-14H2,1H3 |
| InChIKey | SASPGZYNFQKABL-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 70.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.34 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|