C23H26BrNO4 — CID 54733848
ethyl 1-(2-bromo-1-hydroxypropyl)-4-hydroxy-2,6-diphenyl-3,6-dihydro-2H-pyridine-5-carboxylate (PubChem CID 54733848) has the molecular formula C23H26BrNO4 and a molecular weight of 460.37 g/mol. Its IUPAC name is ethyl 1-(2-bromo-1-hydroxypropyl)-4-hydroxy-2,6-diphenyl-3,6-dihydro-2H-pyridine-5-carboxylate.
| Compound Name | ethyl 1-(2-bromo-1-hydroxypropyl)-4-hydroxy-2,6-diphenyl-3,6-dihydro-2H-pyridine-5-carboxylate |
|---|---|
| PubChem CID | 54733848 |
| Molecular Formula | C23H26BrNO4 |
| Molecular Weight | 460.37 g/mol |
| Exact Mass | 459.10 |
| IUPAC Name | ethyl 1-(2-bromo-1-hydroxypropyl)-4-hydroxy-2,6-diphenyl-3,6-dihydro-2H-pyridine-5-carboxylate |
| SMILES | CCOC(=O)C1=C(O)CC(c2ccccc2)N(C(O)C(C)Br)C1c1ccccc1 |
| InChI | InChI=1S/C23H26BrNO4/c1-3-29-23(28)20-19(26)14-18(16-10-6-4-7-11-16)25(22(27)15(2)24)21(20)17-12-8-5-9-13-17/h4-13,15,18,21-22,26-27H,3,14H2,1-2H3 |
| InChIKey | VQOLLBMSCRRQPS-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 70.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.37 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|