C25H28N2O3 — CID 54733926
2-benzyl-N-(4-cyclohexylphenyl)-4-hydroxy-6-oxo-2,3-dihydro-1H-pyridine-5-carboxamide (PubChem CID 54733926) has the molecular formula C25H28N2O3 and a molecular weight of 404.51 g/mol. Its IUPAC name is 2-benzyl-N-(4-cyclohexylphenyl)-4-hydroxy-6-oxo-2,3-dihydro-1H-pyridine-5-carboxamide.
| Compound Name | 2-benzyl-N-(4-cyclohexylphenyl)-4-hydroxy-6-oxo-2,3-dihydro-1H-pyridine-5-carboxamide |
|---|---|
| PubChem CID | 54733926 |
| Molecular Formula | C25H28N2O3 |
| Molecular Weight | 404.51 g/mol |
| Exact Mass | 404.21 |
| IUPAC Name | 2-benzyl-N-(4-cyclohexylphenyl)-4-hydroxy-6-oxo-2,3-dihydro-1H-pyridine-5-carboxamide |
| SMILES | O=C(Nc1ccc(C2CCCCC2)cc1)C1=C(O)CC(Cc2ccccc2)NC1=O |
| InChI | InChI=1S/C25H28N2O3/c28-22-16-21(15-17-7-3-1-4-8-17)27-25(30)23(22)24(29)26-20-13-11-19(12-14-20)18-9-5-2-6-10-18/h1,3-4,7-8,11-14,18,21,28H,2,5-6,9-10,15-16H2,(H,26,29)(H,27,30) |
| InChIKey | SWHQLBKIZOOTJD-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.51 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|