C24H27N3O3 — CID 54733938
3-hydroxy-5-oxo-2-(2-phenylethyl)-N-(4-piperidin-1-ylphenyl)-1,2-dihydropyrrole-4-carboxamide (PubChem CID 54733938) has the molecular formula C24H27N3O3 and a molecular weight of 405.50 g/mol. Its IUPAC name is 3-hydroxy-5-oxo-2-(2-phenylethyl)-N-(4-piperidin-1-ylphenyl)-1,2-dihydropyrrole-4-carboxamide.
| Compound Name | 3-hydroxy-5-oxo-2-(2-phenylethyl)-N-(4-piperidin-1-ylphenyl)-1,2-dihydropyrrole-4-carboxamide |
|---|---|
| PubChem CID | 54733938 |
| Molecular Formula | C24H27N3O3 |
| Molecular Weight | 405.50 g/mol |
| Exact Mass | 405.21 |
| IUPAC Name | 3-hydroxy-5-oxo-2-(2-phenylethyl)-N-(4-piperidin-1-ylphenyl)-1,2-dihydropyrrole-4-carboxamide |
| SMILES | O=C(Nc1ccc(N2CCCCC2)cc1)C1=C(O)C(CCc2ccccc2)NC1=O |
| InChI | InChI=1S/C24H27N3O3/c28-22-20(14-9-17-7-3-1-4-8-17)26-24(30)21(22)23(29)25-18-10-12-19(13-11-18)27-15-5-2-6-16-27/h1,3-4,7-8,10-13,20,28H,2,5-6,9,14-16H2,(H,25,29)(H,26,30) |
| InChIKey | MGOWFSPLAUIYQB-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 81.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.50 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|