C29H31N3O7 — CID 54734148
(4S,4aS,5aR,14aR)-8-[(cyclopropylamino)methyl]-4-(dimethylamino)-1,12,13,14a-tetrahydroxy-3,14-dioxo-4a,5,5a,6-tetrahydro-4H-pentacene-2-carboxamide (PubChem CID 54734148) has the molecular formula C29H31N3O7 and a molecular weight of 533.58 g/mol. Its IUPAC name is (4S,4aS,5aR,14aR)-8-[(cyclopropylamino)methyl]-4-(dimethylamino)-1,12,13,14a-tetrahydroxy-3,14-dioxo-4a,5,5a,6-tetrahydro-4H-pentacene-2-carboxamide.
| Compound Name | (4S,4aS,5aR,14aR)-8-[(cyclopropylamino)methyl]-4-(dimethylamino)-1,12,13,14a-tetrahydroxy-3,14-dioxo-4a,5,5a,6-tetrahydro-4H-pentacene-2-carboxamide |
|---|---|
| PubChem CID | 54734148 |
| Molecular Formula | C29H31N3O7 |
| Molecular Weight | 533.58 g/mol |
| Exact Mass | 533.22 |
| IUPAC Name | (4S,4aS,5aR,14aR)-8-[(cyclopropylamino)methyl]-4-(dimethylamino)-1,12,13,14a-tetrahydroxy-3,14-dioxo-4a,5,5a,6-tetrahydro-4H-pentacene-2-carboxamide |
| SMILES | CN(C)[C@@H]1C(=O)C(C(N)=O)=C(O)[C@@]2(O)C(=O)C3=C(O)c4c(cc5c(CNC6CC6)cccc5c4O)C[C@H]3C[C@@H]12 |
| InChI | InChI=1S/C29H31N3O7/c1-32(2)22-18-10-14-8-13-9-17-12(11-31-15-6-7-15)4-3-5-16(17)23(33)19(13)24(34)20(14)26(36)29(18,39)27(37)21(25(22)35)28(30)38/h3-5,9,14-15,18,22,31,33-34,37,39H,6-8,10-11H2,1-2H3,(H2,30,38)/t14-,18-,22-,29-/m0/s1 |
| InChIKey | ZLLRDEPMOQMVQG-LHDKEYSKSA-N |
| XLogP | 1.37 |
| TPSA | 173.42 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.58 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|