C31H35N3O7 — CID 54734151
(4S,4aS,5aR,14aR)-4-(dimethylamino)-1,12,13,14a-tetrahydroxy-3,14-dioxo-10-(piperidin-1-ylmethyl)-4a,5,5a,6-tetrahydro-4H-pentacene-2-carboxamide (PubChem CID 54734151) has the molecular formula C31H35N3O7 and a molecular weight of 561.64 g/mol. Its IUPAC name is (4S,4aS,5aR,14aR)-4-(dimethylamino)-1,12,13,14a-tetrahydroxy-3,14-dioxo-10-(piperidin-1-ylmethyl)-4a,5,5a,6-tetrahydro-4H-pentacene-2-carboxamide.
| Compound Name | (4S,4aS,5aR,14aR)-4-(dimethylamino)-1,12,13,14a-tetrahydroxy-3,14-dioxo-10-(piperidin-1-ylmethyl)-4a,5,5a,6-tetrahydro-4H-pentacene-2-carboxamide |
|---|---|
| PubChem CID | 54734151 |
| Molecular Formula | C31H35N3O7 |
| Molecular Weight | 561.64 g/mol |
| Exact Mass | 561.25 |
| IUPAC Name | (4S,4aS,5aR,14aR)-4-(dimethylamino)-1,12,13,14a-tetrahydroxy-3,14-dioxo-10-(piperidin-1-ylmethyl)-4a,5,5a,6-tetrahydro-4H-pentacene-2-carboxamide |
| SMILES | CN(C)[C@@H]1C(=O)C(C(N)=O)=C(O)[C@@]2(O)C(=O)C3=C(O)c4c(cc5ccc(CN6CCCCC6)cc5c4O)C[C@H]3C[C@@H]12 |
| InChI | InChI=1S/C31H35N3O7/c1-33(2)24-20-13-18-12-17-11-16-7-6-15(14-34-8-4-3-5-9-34)10-19(16)25(35)21(17)26(36)22(18)28(38)31(20,41)29(39)23(27(24)37)30(32)40/h6-7,10-11,18,20,24,35-36,39,41H,3-5,8-9,12-14H2,1-2H3,(H2,32,40)/t18-,20-,24-,31-/m0/s1 |
| InChIKey | SURRIAMWLUXNJB-YSZMQTSISA-N |
| XLogP | 2.10 |
| TPSA | 164.63 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.64 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|