C29H30FN3O7 — CID 54734165
(4S,4aS,5aR,14aR)-10-(azetidin-1-ylmethyl)-4-(dimethylamino)-7-fluoro-1,12,13,14a-tetrahydroxy-3,14-dioxo-4a,5,5a,6-tetrahydro-4H-pentacene-2-carboxamide (PubChem CID 54734165) has the molecular formula C29H30FN3O7 and a molecular weight of 551.57 g/mol. Its IUPAC name is (4S,4aS,5aR,14aR)-10-(azetidin-1-ylmethyl)-4-(dimethylamino)-7-fluoro-1,12,13,14a-tetrahydroxy-3,14-dioxo-4a,5,5a,6-tetrahydro-4H-pentacene-2-carboxamide.
| Compound Name | (4S,4aS,5aR,14aR)-10-(azetidin-1-ylmethyl)-4-(dimethylamino)-7-fluoro-1,12,13,14a-tetrahydroxy-3,14-dioxo-4a,5,5a,6-tetrahydro-4H-pentacene-2-carboxamide |
|---|---|
| PubChem CID | 54734165 |
| Molecular Formula | C29H30FN3O7 |
| Molecular Weight | 551.57 g/mol |
| Exact Mass | 551.21 |
| IUPAC Name | (4S,4aS,5aR,14aR)-10-(azetidin-1-ylmethyl)-4-(dimethylamino)-7-fluoro-1,12,13,14a-tetrahydroxy-3,14-dioxo-4a,5,5a,6-tetrahydro-4H-pentacene-2-carboxamide |
| SMILES | CN(C)[C@@H]1C(=O)C(C(N)=O)=C(O)[C@@]2(O)C(=O)C3=C(O)c4c(c(F)c5ccc(CN6CCC6)cc5c4O)C[C@H]3C[C@@H]12 |
| InChI | InChI=1S/C29H30FN3O7/c1-32(2)22-17-10-13-9-16-19(23(34)15-8-12(11-33-6-3-7-33)4-5-14(15)21(16)30)24(35)18(13)26(37)29(17,40)27(38)20(25(22)36)28(31)39/h4-5,8,13,17,22,34-35,38,40H,3,6-7,9-11H2,1-2H3,(H2,31,39)/t13-,17-,22-,29-/m0/s1 |
| InChIKey | CNWNYMSLWVOCRV-PYDSOPTGSA-N |
| XLogP | 1.46 |
| TPSA | 164.63 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.57 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|