C30H27N3O7 — CID 54734167
(4S,4aS,5aR,14aR)-4-(dimethylamino)-1,12,13,14a-tetrahydroxy-3,14-dioxo-10-pyridin-3-yl-4a,5,5a,6-tetrahydro-4H-pentacene-2-carboxamide (PubChem CID 54734167) has the molecular formula C30H27N3O7 and a molecular weight of 541.56 g/mol. Its IUPAC name is (4S,4aS,5aR,14aR)-4-(dimethylamino)-1,12,13,14a-tetrahydroxy-3,14-dioxo-10-pyridin-3-yl-4a,5,5a,6-tetrahydro-4H-pentacene-2-carboxamide.
| Compound Name | (4S,4aS,5aR,14aR)-4-(dimethylamino)-1,12,13,14a-tetrahydroxy-3,14-dioxo-10-pyridin-3-yl-4a,5,5a,6-tetrahydro-4H-pentacene-2-carboxamide |
|---|---|
| PubChem CID | 54734167 |
| Molecular Formula | C30H27N3O7 |
| Molecular Weight | 541.56 g/mol |
| Exact Mass | 541.18 |
| IUPAC Name | (4S,4aS,5aR,14aR)-4-(dimethylamino)-1,12,13,14a-tetrahydroxy-3,14-dioxo-10-pyridin-3-yl-4a,5,5a,6-tetrahydro-4H-pentacene-2-carboxamide |
| SMILES | CN(C)[C@@H]1C(=O)C(C(N)=O)=C(O)[C@@]2(O)C(=O)C3=C(O)c4c(cc5ccc(-c6cccnc6)cc5c4O)C[C@H]3C[C@@H]12 |
| InChI | InChI=1S/C30H27N3O7/c1-33(2)23-19-11-17-9-16-8-14-6-5-13(15-4-3-7-32-12-15)10-18(14)24(34)20(16)25(35)21(17)27(37)30(19,40)28(38)22(26(23)36)29(31)39/h3-8,10,12,17,19,23,34-35,38,40H,9,11H2,1-2H3,(H2,31,39)/t17-,19-,23-,30-/m0/s1 |
| InChIKey | JAJIKHBPPBOTLD-FVJNVVATSA-N |
| XLogP | 2.18 |
| TPSA | 174.28 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.56 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|