About 2-hydroxy-4,4-dimethyl-6-oxo-N-phenylcyclohexene-1-carboxamide
2-hydroxy-4,4-dimethyl-6-oxo-N-phenylcyclohexene-1-carboxamide (PubChem CID 54734179) has the molecular formula C15H17NO3
and a molecular weight of 259.31 g/mol. Its IUPAC name is 2-hydroxy-4,4-dimethyl-6-oxo-N-phenylcyclohexene-1-carboxamide.
Molecular Properties
| Compound Name | 2-hydroxy-4,4-dimethyl-6-oxo-N-phenylcyclohexene-1-carboxamide |
| PubChem CID | 54734179 |
| Molecular Formula | C15H17NO3 |
| Molecular Weight | 259.31 g/mol |
| Exact Mass | 259.12 |
| IUPAC Name | 2-hydroxy-4,4-dimethyl-6-oxo-N-phenylcyclohexene-1-carboxamide |
| SMILES | CC1(C)CC(=O)C(C(=O)Nc2ccccc2)=C(O)C1 |
| InChI | InChI=1S/C15H17NO3/c1-15(2)8-11(17)13(12(18)9-15)14(19)16-10-6-4-3-5-7-10/h3-7,17H,8-9H2,1-2H3,(H,16,19) |
| InChIKey | SQDWNHRSJXSPSO-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 259.31 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|
Analyze 2-hydroxy-4,4-dimethyl-6-oxo-N-phenylcyclohexene-1-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-hydroxy-4,4-dimethyl-6-oxo-N-phenylcyclohexene-1-carboxamide?
The IUPAC name of 2-hydroxy-4,4-dimethyl-6-oxo-N-phenylcyclohexene-1-carboxamide (CID 54734179) is 2-hydroxy-4,4-dimethyl-6-oxo-N-phenylcyclohexene-1-carboxamide.
What is the SMILES notation for 2-hydroxy-4,4-dimethyl-6-oxo-N-phenylcyclohexene-1-carboxamide?
The canonical SMILES for 2-hydroxy-4,4-dimethyl-6-oxo-N-phenylcyclohexene-1-carboxamide is CC1(C)CC(=O)C(C(=O)Nc2ccccc2)=C(O)C1.
What is the InChIKey of 2-hydroxy-4,4-dimethyl-6-oxo-N-phenylcyclohexene-1-carboxamide?
The InChIKey is SQDWNHRSJXSPSO-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H17NO3/c1-15(2)8-11(17)13(12(18)9-15)14(19)16-10-6-4-3-5-7-10/h3-7,17H,8-9H2,1-2H3,(H,16,19).
What are the key properties of 2-hydroxy-4,4-dimethyl-6-oxo-N-phenylcyclohexene-1-carboxamide?
2-hydroxy-4,4-dimethyl-6-oxo-N-phenylcyclohexene-1-carboxamide has a molecular weight of 259.31 g/mol, XLogP of 2.83, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-hydroxy-4,4-dimethyl-6-oxo-N-phenylcyclohexene-1-carboxamide is sourced from PubChem (CID 54734179), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).