About 4-hydroxypyrano[3,2-b]pyridin-2-one
4-hydroxypyrano[3,2-b]pyridin-2-one (PubChem CID 54734203) has the molecular formula C8H5NO3
and a molecular weight of 163.13 g/mol. Its IUPAC name is 4-hydroxypyrano[3,2-b]pyridin-2-one.
Molecular Properties
| Compound Name | 4-hydroxypyrano[3,2-b]pyridin-2-one |
| PubChem CID | 54734203 |
| Molecular Formula | C8H5NO3 |
| Molecular Weight | 163.13 g/mol |
| Exact Mass | 163.03 |
| IUPAC Name | 4-hydroxypyrano[3,2-b]pyridin-2-one |
| SMILES | O=c1cc(O)c2ncccc2o1 |
| InChI | InChI=1S/C8H5NO3/c10-5-4-7(11)12-6-2-1-3-9-8(5)6/h1-4,10H |
| InChIKey | HHSOESOBCICGMY-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 63.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 163.13 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-hydroxypyrano[3,2-b]pyridin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-hydroxypyrano[3,2-b]pyridin-2-one?
The IUPAC name of 4-hydroxypyrano[3,2-b]pyridin-2-one (CID 54734203) is 4-hydroxypyrano[3,2-b]pyridin-2-one.
What is the SMILES notation for 4-hydroxypyrano[3,2-b]pyridin-2-one?
The canonical SMILES for 4-hydroxypyrano[3,2-b]pyridin-2-one is O=c1cc(O)c2ncccc2o1.
What is the InChIKey of 4-hydroxypyrano[3,2-b]pyridin-2-one?
The InChIKey is HHSOESOBCICGMY-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H5NO3/c10-5-4-7(11)12-6-2-1-3-9-8(5)6/h1-4,10H.
What are the key properties of 4-hydroxypyrano[3,2-b]pyridin-2-one?
4-hydroxypyrano[3,2-b]pyridin-2-one has a molecular weight of 163.13 g/mol, XLogP of 0.89, 0 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-hydroxypyrano[3,2-b]pyridin-2-one is sourced from PubChem (CID 54734203), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).