C26H31N3O4S — CID 54734223
N-[4-hydroxy-2-oxo-3-[4-(4-phenyl-3,6-dihydro-2H-pyridin-1-yl)butyl]-1H-quinolin-6-yl]ethanesulfonamide (PubChem CID 54734223) has the molecular formula C26H31N3O4S and a molecular weight of 481.62 g/mol. Its IUPAC name is N-[4-hydroxy-2-oxo-3-[4-(4-phenyl-3,6-dihydro-2H-pyridin-1-yl)butyl]-1H-quinolin-6-yl]ethanesulfonamide.
| Compound Name | N-[4-hydroxy-2-oxo-3-[4-(4-phenyl-3,6-dihydro-2H-pyridin-1-yl)butyl]-1H-quinolin-6-yl]ethanesulfonamide |
|---|---|
| PubChem CID | 54734223 |
| Molecular Formula | C26H31N3O4S |
| Molecular Weight | 481.62 g/mol |
| Exact Mass | 481.20 |
| IUPAC Name | N-[4-hydroxy-2-oxo-3-[4-(4-phenyl-3,6-dihydro-2H-pyridin-1-yl)butyl]-1H-quinolin-6-yl]ethanesulfonamide |
| SMILES | CCS(=O)(=O)Nc1ccc2[nH]c(=O)c(CCCCN3CC=C(c4ccccc4)CC3)c(O)c2c1 |
| InChI | InChI=1S/C26H31N3O4S/c1-2-34(32,33)28-21-11-12-24-23(18-21)25(30)22(26(31)27-24)10-6-7-15-29-16-13-20(14-17-29)19-8-4-3-5-9-19/h3-5,8-9,11-13,18,28H,2,6-7,10,14-17H2,1H3,(H2,27,30,31) |
| InChIKey | YJQMFPUPRBYKSY-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 102.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.62 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|