C9H6O6-2 — CID 54734238
(2E,4Z,7E)-9-hydroxy-2-oxido-6,9-dioxonona-2,4,7-trienoate (PubChem CID 54734238) has the molecular formula C9H6O6-2 and a molecular weight of 210.14 g/mol. Its IUPAC name is (2E,4Z,7E)-9-hydroxy-2-oxido-6,9-dioxonona-2,4,7-trienoate.
| Compound Name | (2E,4Z,7E)-9-hydroxy-2-oxido-6,9-dioxonona-2,4,7-trienoate |
|---|---|
| PubChem CID | 54734238 |
| Molecular Formula | C9H6O6-2 |
| Molecular Weight | 210.14 g/mol |
| Exact Mass | 210.02 |
| IUPAC Name | (2E,4Z,7E)-9-hydroxy-2-oxido-6,9-dioxonona-2,4,7-trienoate |
| SMILES | O=C(O)/C=C/C(=O)/C=C\C=C(\[O-])C(=O)[O-] |
| InChI | InChI=1S/C9H8O6/c10-6(4-5-8(12)13)2-1-3-7(11)9(14)15/h1-5,11H,(H,12,13)(H,14,15)/p-2/b2-1-,5-4+,7-3+ |
| InChIKey | WCJYZUFKKTYNLB-PFCALIJCSA-L |
| XLogP | -2.25 |
| TPSA | 117.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.14 |
| LogP ≤ 5 | -2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|