About 3-benzyl-1,4-dihydroxy-6-phenyl-1,8-naphthyridin-2-one
3-benzyl-1,4-dihydroxy-6-phenyl-1,8-naphthyridin-2-one (PubChem CID 54735024) has the molecular formula C21H16N2O3
and a molecular weight of 344.37 g/mol. Its IUPAC name is 3-benzyl-1,4-dihydroxy-6-phenyl-1,8-naphthyridin-2-one.
Molecular Properties
| Compound Name | 3-benzyl-1,4-dihydroxy-6-phenyl-1,8-naphthyridin-2-one |
| PubChem CID | 54735024 |
| Molecular Formula | C21H16N2O3 |
| Molecular Weight | 344.37 g/mol |
| Exact Mass | 344.12 |
| IUPAC Name | 3-benzyl-1,4-dihydroxy-6-phenyl-1,8-naphthyridin-2-one |
| SMILES | O=c1c(Cc2ccccc2)c(O)c2cc(-c3ccccc3)cnc2n1O |
| InChI | InChI=1S/C21H16N2O3/c24-19-17-12-16(15-9-5-2-6-10-15)13-22-20(17)23(26)21(25)18(19)11-14-7-3-1-4-8-14/h1-10,12-13,24,26H,11H2 |
| InChIKey | VZTXXLWWDQHFNB-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 344.37 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 3-benzyl-1,4-dihydroxy-6-phenyl-1,8-naphthyridin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-benzyl-1,4-dihydroxy-6-phenyl-1,8-naphthyridin-2-one?
The IUPAC name of 3-benzyl-1,4-dihydroxy-6-phenyl-1,8-naphthyridin-2-one (CID 54735024) is 3-benzyl-1,4-dihydroxy-6-phenyl-1,8-naphthyridin-2-one.
What is the SMILES notation for 3-benzyl-1,4-dihydroxy-6-phenyl-1,8-naphthyridin-2-one?
The canonical SMILES for 3-benzyl-1,4-dihydroxy-6-phenyl-1,8-naphthyridin-2-one is O=c1c(Cc2ccccc2)c(O)c2cc(-c3ccccc3)cnc2n1O.
What is the InChIKey of 3-benzyl-1,4-dihydroxy-6-phenyl-1,8-naphthyridin-2-one?
The InChIKey is VZTXXLWWDQHFNB-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H16N2O3/c24-19-17-12-16(15-9-5-2-6-10-15)13-22-20(17)23(26)21(25)18(19)11-14-7-3-1-4-8-14/h1-10,12-13,24,26H,11H2.
What are the key properties of 3-benzyl-1,4-dihydroxy-6-phenyl-1,8-naphthyridin-2-one?
3-benzyl-1,4-dihydroxy-6-phenyl-1,8-naphthyridin-2-one has a molecular weight of 344.37 g/mol, XLogP of 3.60, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-benzyl-1,4-dihydroxy-6-phenyl-1,8-naphthyridin-2-one is sourced from PubChem (CID 54735024), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).