C15H13N3O5S — CID 54735028
1,4-dihydroxy-6-[3-(methoxysulfinylamino)phenyl]-2-oxo-1,8-naphthyridine (PubChem CID 54735028) has the molecular formula C15H13N3O5S and a molecular weight of 347.35 g/mol. Its IUPAC name is 1,4-dihydroxy-6-[3-(methoxysulfinylamino)phenyl]-2-oxo-1,8-naphthyridine.
| Compound Name | 1,4-dihydroxy-6-[3-(methoxysulfinylamino)phenyl]-2-oxo-1,8-naphthyridine |
|---|---|
| PubChem CID | 54735028 |
| Molecular Formula | C15H13N3O5S |
| Molecular Weight | 347.35 g/mol |
| Exact Mass | 347.06 |
| IUPAC Name | 1,4-dihydroxy-6-[3-(methoxysulfinylamino)phenyl]-2-oxo-1,8-naphthyridine |
| SMILES | COS(=O)Nc1cccc(-c2cnc3c(c2)c(O)cc(=O)n3O)c1 |
| InChI | InChI=1S/C15H13N3O5S/c1-23-24(22)17-11-4-2-3-9(5-11)10-6-12-13(19)7-14(20)18(21)15(12)16-8-10/h2-8,17,19,21H,1H3 |
| InChIKey | NQZKBEUJPXQLJF-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 113.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.35 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'} |
|---|