About 1,4-dihydroxy-3-phenyl-6-thiophen-2-yl-1,8-naphthyridin-2-one
1,4-dihydroxy-3-phenyl-6-thiophen-2-yl-1,8-naphthyridin-2-one (PubChem CID 54735043) has the molecular formula C18H12N2O3S
and a molecular weight of 336.37 g/mol. Its IUPAC name is 1,4-dihydroxy-3-phenyl-6-thiophen-2-yl-1,8-naphthyridin-2-one.
Molecular Properties
| Compound Name | 1,4-dihydroxy-3-phenyl-6-thiophen-2-yl-1,8-naphthyridin-2-one |
| PubChem CID | 54735043 |
| Molecular Formula | C18H12N2O3S |
| Molecular Weight | 336.37 g/mol |
| Exact Mass | 336.06 |
| IUPAC Name | 1,4-dihydroxy-3-phenyl-6-thiophen-2-yl-1,8-naphthyridin-2-one |
| SMILES | O=c1c(-c2ccccc2)c(O)c2cc(-c3cccs3)cnc2n1O |
| InChI | InChI=1S/C18H12N2O3S/c21-16-13-9-12(14-7-4-8-24-14)10-19-17(13)20(23)18(22)15(16)11-5-2-1-3-6-11/h1-10,21,23H |
| InChIKey | GGJLQHIXOLCDOY-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 336.37 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 1,4-dihydroxy-3-phenyl-6-thiophen-2-yl-1,8-naphthyridin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,4-dihydroxy-3-phenyl-6-thiophen-2-yl-1,8-naphthyridin-2-one?
The IUPAC name of 1,4-dihydroxy-3-phenyl-6-thiophen-2-yl-1,8-naphthyridin-2-one (CID 54735043) is 1,4-dihydroxy-3-phenyl-6-thiophen-2-yl-1,8-naphthyridin-2-one.
What is the SMILES notation for 1,4-dihydroxy-3-phenyl-6-thiophen-2-yl-1,8-naphthyridin-2-one?
The canonical SMILES for 1,4-dihydroxy-3-phenyl-6-thiophen-2-yl-1,8-naphthyridin-2-one is O=c1c(-c2ccccc2)c(O)c2cc(-c3cccs3)cnc2n1O.
What is the InChIKey of 1,4-dihydroxy-3-phenyl-6-thiophen-2-yl-1,8-naphthyridin-2-one?
The InChIKey is GGJLQHIXOLCDOY-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H12N2O3S/c21-16-13-9-12(14-7-4-8-24-14)10-19-17(13)20(23)18(22)15(16)11-5-2-1-3-6-11/h1-10,21,23H.
What are the key properties of 1,4-dihydroxy-3-phenyl-6-thiophen-2-yl-1,8-naphthyridin-2-one?
1,4-dihydroxy-3-phenyl-6-thiophen-2-yl-1,8-naphthyridin-2-one has a molecular weight of 336.37 g/mol, XLogP of 3.73, 2 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1,4-dihydroxy-3-phenyl-6-thiophen-2-yl-1,8-naphthyridin-2-one is sourced from PubChem (CID 54735043), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).