C25H27N3O6 — CID 54735050
ethyl 1,4-dihydroxy-2-oxo-6-[2-(2-phenylethyl)piperidine-1-carbonyl]-1,8-naphthyridine-3-carboxylate (PubChem CID 54735050) has the molecular formula C25H27N3O6 and a molecular weight of 465.51 g/mol. Its IUPAC name is ethyl 1,4-dihydroxy-2-oxo-6-[2-(2-phenylethyl)piperidine-1-carbonyl]-1,8-naphthyridine-3-carboxylate.
| Compound Name | ethyl 1,4-dihydroxy-2-oxo-6-[2-(2-phenylethyl)piperidine-1-carbonyl]-1,8-naphthyridine-3-carboxylate |
|---|---|
| PubChem CID | 54735050 |
| Molecular Formula | C25H27N3O6 |
| Molecular Weight | 465.51 g/mol |
| Exact Mass | 465.19 |
| IUPAC Name | ethyl 1,4-dihydroxy-2-oxo-6-[2-(2-phenylethyl)piperidine-1-carbonyl]-1,8-naphthyridine-3-carboxylate |
| SMILES | CCOC(=O)c1c(O)c2cc(C(=O)N3CCCCC3CCc3ccccc3)cnc2n(O)c1=O |
| InChI | InChI=1S/C25H27N3O6/c1-2-34-25(32)20-21(29)19-14-17(15-26-22(19)28(33)24(20)31)23(30)27-13-7-6-10-18(27)12-11-16-8-4-3-5-9-16/h3-5,8-9,14-15,18,29,33H,2,6-7,10-13H2,1H3 |
| InChIKey | JPRIANMINPOORO-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 121.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.51 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'} |
|---|