C26H29N3O6 — CID 54735051
ethyl 1,4-dihydroxy-2-oxo-6-[4-(3-phenylpropyl)piperidine-1-carbonyl]-1,8-naphthyridine-3-carboxylate (PubChem CID 54735051) has the molecular formula C26H29N3O6 and a molecular weight of 479.53 g/mol. Its IUPAC name is ethyl 1,4-dihydroxy-2-oxo-6-[4-(3-phenylpropyl)piperidine-1-carbonyl]-1,8-naphthyridine-3-carboxylate.
| Compound Name | ethyl 1,4-dihydroxy-2-oxo-6-[4-(3-phenylpropyl)piperidine-1-carbonyl]-1,8-naphthyridine-3-carboxylate |
|---|---|
| PubChem CID | 54735051 |
| Molecular Formula | C26H29N3O6 |
| Molecular Weight | 479.53 g/mol |
| Exact Mass | 479.21 |
| IUPAC Name | ethyl 1,4-dihydroxy-2-oxo-6-[4-(3-phenylpropyl)piperidine-1-carbonyl]-1,8-naphthyridine-3-carboxylate |
| SMILES | CCOC(=O)c1c(O)c2cc(C(=O)N3CCC(CCCc4ccccc4)CC3)cnc2n(O)c1=O |
| InChI | InChI=1S/C26H29N3O6/c1-2-35-26(33)21-22(30)20-15-19(16-27-23(20)29(34)25(21)32)24(31)28-13-11-18(12-14-28)10-6-9-17-7-4-3-5-8-17/h3-5,7-8,15-16,18,30,34H,2,6,9-14H2,1H3 |
| InChIKey | LKFMVUUODFIRPA-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 121.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.53 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'} |
|---|