C18H16BrN3O4S — CID 54735305
N-[(E)-1-(2-bromophenyl)ethylideneamino]-4-hydroxy-2-methyl-1,1-dioxo-1λ6,2-benzothiazine-3-carboxamide (PubChem CID 54735305) has the molecular formula C18H16BrN3O4S and a molecular weight of 450.31 g/mol. Its IUPAC name is N-[(E)-1-(2-bromophenyl)ethylideneamino]-4-hydroxy-2-methyl-1,1-dioxo-1λ6,2-benzothiazine-3-carboxamide.
| Compound Name | N-[(E)-1-(2-bromophenyl)ethylideneamino]-4-hydroxy-2-methyl-1,1-dioxo-1λ6,2-benzothiazine-3-carboxamide |
|---|---|
| PubChem CID | 54735305 |
| Molecular Formula | C18H16BrN3O4S |
| Molecular Weight | 450.31 g/mol |
| Exact Mass | 449.00 |
| IUPAC Name | N-[(E)-1-(2-bromophenyl)ethylideneamino]-4-hydroxy-2-methyl-1,1-dioxo-1λ6,2-benzothiazine-3-carboxamide |
| SMILES | C/C(=N\NC(=O)C1=C(O)c2ccccc2S(=O)(=O)N1C)c1ccccc1Br |
| InChI | InChI=1S/C18H16BrN3O4S/c1-11(12-7-3-5-9-14(12)19)20-21-18(24)16-17(23)13-8-4-6-10-15(13)27(25,26)22(16)2/h3-10,23H,1-2H3,(H,21,24)/b20-11+ |
| InChIKey | VRNBNHDRRKTINU-RGVLZGJSSA-N |
| XLogP | 2.85 |
| TPSA | 99.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.31 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|