About butyl 2-[[2-(1,2-dihydroxyethyl)-3-hydroxy-5-oxo-2H-furan-4-yl]oxy]acetate
butyl 2-[[2-(1,2-dihydroxyethyl)-3-hydroxy-5-oxo-2H-furan-4-yl]oxy]acetate (PubChem CID 54735456) has the molecular formula C12H18O8
and a molecular weight of 290.27 g/mol. Its IUPAC name is butyl 2-[[2-(1,2-dihydroxyethyl)-3-hydroxy-5-oxo-2H-furan-4-yl]oxy]acetate.
Molecular Properties
| Compound Name | butyl 2-[[2-(1,2-dihydroxyethyl)-3-hydroxy-5-oxo-2H-furan-4-yl]oxy]acetate |
| PubChem CID | 54735456 |
| Molecular Formula | C12H18O8 |
| Molecular Weight | 290.27 g/mol |
| Exact Mass | 290.10 |
| IUPAC Name | butyl 2-[[2-(1,2-dihydroxyethyl)-3-hydroxy-5-oxo-2H-furan-4-yl]oxy]acetate |
| SMILES | CCCCOC(=O)COC1=C(O)C(C(O)CO)OC1=O |
| InChI | InChI=1S/C12H18O8/c1-2-3-4-18-8(15)6-19-11-9(16)10(7(14)5-13)20-12(11)17/h7,10,13-14,16H,2-6H2,1H3 |
| InChIKey | UHVUSUNSWNRSSM-UHFFFAOYSA-N |
| XLogP | -0.61 |
| TPSA | 122.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 290.27 |
| LogP ≤ 5 | -0.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze butyl 2-[[2-(1,2-dihydroxyethyl)-3-hydroxy-5-oxo-2H-furan-4-yl]oxy]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butyl 2-[[2-(1,2-dihydroxyethyl)-3-hydroxy-5-oxo-2H-furan-4-yl]oxy]acetate?
The IUPAC name of butyl 2-[[2-(1,2-dihydroxyethyl)-3-hydroxy-5-oxo-2H-furan-4-yl]oxy]acetate (CID 54735456) is butyl 2-[[2-(1,2-dihydroxyethyl)-3-hydroxy-5-oxo-2H-furan-4-yl]oxy]acetate.
What is the SMILES notation for butyl 2-[[2-(1,2-dihydroxyethyl)-3-hydroxy-5-oxo-2H-furan-4-yl]oxy]acetate?
The canonical SMILES for butyl 2-[[2-(1,2-dihydroxyethyl)-3-hydroxy-5-oxo-2H-furan-4-yl]oxy]acetate is CCCCOC(=O)COC1=C(O)C(C(O)CO)OC1=O.
What is the InChIKey of butyl 2-[[2-(1,2-dihydroxyethyl)-3-hydroxy-5-oxo-2H-furan-4-yl]oxy]acetate?
The InChIKey is UHVUSUNSWNRSSM-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H18O8/c1-2-3-4-18-8(15)6-19-11-9(16)10(7(14)5-13)20-12(11)17/h7,10,13-14,16H,2-6H2,1H3.
What are the key properties of butyl 2-[[2-(1,2-dihydroxyethyl)-3-hydroxy-5-oxo-2H-furan-4-yl]oxy]acetate?
butyl 2-[[2-(1,2-dihydroxyethyl)-3-hydroxy-5-oxo-2H-furan-4-yl]oxy]acetate has a molecular weight of 290.27 g/mol, XLogP of -0.61, 8 rotatable bonds, 3 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for butyl 2-[[2-(1,2-dihydroxyethyl)-3-hydroxy-5-oxo-2H-furan-4-yl]oxy]acetate is sourced from PubChem (CID 54735456), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).