About 3-hex-3-enoxy-4,5-dihydroxychromen-2-one
3-hex-3-enoxy-4,5-dihydroxychromen-2-one (PubChem CID 54735998) has the molecular formula C15H16O5
and a molecular weight of 276.29 g/mol. Its IUPAC name is 3-hex-3-enoxy-4,5-dihydroxychromen-2-one.
Molecular Properties
| Compound Name | 3-hex-3-enoxy-4,5-dihydroxychromen-2-one |
| PubChem CID | 54735998 |
| Molecular Formula | C15H16O5 |
| Molecular Weight | 276.29 g/mol |
| Exact Mass | 276.10 |
| IUPAC Name | 3-hex-3-enoxy-4,5-dihydroxychromen-2-one |
| SMILES | CCC=CCCOc1c(O)c2c(O)cccc2oc1=O |
| InChI | InChI=1S/C15H16O5/c1-2-3-4-5-9-19-14-13(17)12-10(16)7-6-8-11(12)20-15(14)18/h3-4,6-8,16-17H,2,5,9H2,1H3 |
| InChIKey | UBJHSDBJUXKRDB-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 276.29 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 3-hex-3-enoxy-4,5-dihydroxychromen-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-hex-3-enoxy-4,5-dihydroxychromen-2-one?
The IUPAC name of 3-hex-3-enoxy-4,5-dihydroxychromen-2-one (CID 54735998) is 3-hex-3-enoxy-4,5-dihydroxychromen-2-one.
What is the SMILES notation for 3-hex-3-enoxy-4,5-dihydroxychromen-2-one?
The canonical SMILES for 3-hex-3-enoxy-4,5-dihydroxychromen-2-one is CCC=CCCOc1c(O)c2c(O)cccc2oc1=O.
What is the InChIKey of 3-hex-3-enoxy-4,5-dihydroxychromen-2-one?
The InChIKey is UBJHSDBJUXKRDB-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H16O5/c1-2-3-4-5-9-19-14-13(17)12-10(16)7-6-8-11(12)20-15(14)18/h3-4,6-8,16-17H,2,5,9H2,1H3.
What are the key properties of 3-hex-3-enoxy-4,5-dihydroxychromen-2-one?
3-hex-3-enoxy-4,5-dihydroxychromen-2-one has a molecular weight of 276.29 g/mol, XLogP of 2.94, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-hex-3-enoxy-4,5-dihydroxychromen-2-one is sourced from PubChem (CID 54735998), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).