C30H34FN3O7 — CID 54736265
(4S,4aS,5aR,14aR)-10-[(tert-butylamino)methyl]-4-(dimethylamino)-7-fluoro-1,12,13,14a-tetrahydroxy-3,14-dioxo-4a,5,5a,6-tetrahydro-4H-pentacene-2-carboxamide (PubChem CID 54736265) has the molecular formula C30H34FN3O7 and a molecular weight of 567.61 g/mol. Its IUPAC name is (4S,4aS,5aR,14aR)-10-[(tert-butylamino)methyl]-4-(dimethylamino)-7-fluoro-1,12,13,14a-tetrahydroxy-3,14-dioxo-4a,5,5a,6-tetrahydro-4H-pentacene-2-carboxamide.
| Compound Name | (4S,4aS,5aR,14aR)-10-[(tert-butylamino)methyl]-4-(dimethylamino)-7-fluoro-1,12,13,14a-tetrahydroxy-3,14-dioxo-4a,5,5a,6-tetrahydro-4H-pentacene-2-carboxamide |
|---|---|
| PubChem CID | 54736265 |
| Molecular Formula | C30H34FN3O7 |
| Molecular Weight | 567.61 g/mol |
| Exact Mass | 567.24 |
| IUPAC Name | (4S,4aS,5aR,14aR)-10-[(tert-butylamino)methyl]-4-(dimethylamino)-7-fluoro-1,12,13,14a-tetrahydroxy-3,14-dioxo-4a,5,5a,6-tetrahydro-4H-pentacene-2-carboxamide |
| SMILES | CN(C)[C@@H]1C(=O)C(C(N)=O)=C(O)[C@@]2(O)C(=O)C3=C(O)c4c(c(F)c5ccc(CNC(C)(C)C)cc5c4O)C[C@H]3C[C@@H]12 |
| InChI | InChI=1S/C30H34FN3O7/c1-29(2,3)33-11-12-6-7-14-15(8-12)23(35)19-16(21(14)31)9-13-10-17-22(34(4)5)25(37)20(28(32)40)27(39)30(17,41)26(38)18(13)24(19)36/h6-8,13,17,22,33,35-36,39,41H,9-11H2,1-5H3,(H2,32,40)/t13-,17-,22-,30-/m0/s1 |
| InChIKey | FANQKGACUVESOI-OBNYTXPLSA-N |
| XLogP | 2.14 |
| TPSA | 173.42 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.61 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|