About 3-[(3,4-dimethylphenyl)methyl]-4-hydroxy-6,7-dimethylchromen-2-one
3-[(3,4-dimethylphenyl)methyl]-4-hydroxy-6,7-dimethylchromen-2-one (PubChem CID 54736429) has the molecular formula C20H20O3
and a molecular weight of 308.38 g/mol. Its IUPAC name is 3-[(3,4-dimethylphenyl)methyl]-4-hydroxy-6,7-dimethylchromen-2-one.
Molecular Properties
| Compound Name | 3-[(3,4-dimethylphenyl)methyl]-4-hydroxy-6,7-dimethylchromen-2-one |
| PubChem CID | 54736429 |
| Molecular Formula | C20H20O3 |
| Molecular Weight | 308.38 g/mol |
| Exact Mass | 308.14 |
| IUPAC Name | 3-[(3,4-dimethylphenyl)methyl]-4-hydroxy-6,7-dimethylchromen-2-one |
| SMILES | Cc1ccc(Cc2c(O)c3cc(C)c(C)cc3oc2=O)cc1C |
| InChI | InChI=1S/C20H20O3/c1-11-5-6-15(7-12(11)2)10-17-19(21)16-8-13(3)14(4)9-18(16)23-20(17)22/h5-9,21H,10H2,1-4H3 |
| InChIKey | NHHOOZBYRFKVFW-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 50.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 308.38 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|
Analyze 3-[(3,4-dimethylphenyl)methyl]-4-hydroxy-6,7-dimethylchromen-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(3,4-dimethylphenyl)methyl]-4-hydroxy-6,7-dimethylchromen-2-one?
The IUPAC name of 3-[(3,4-dimethylphenyl)methyl]-4-hydroxy-6,7-dimethylchromen-2-one (CID 54736429) is 3-[(3,4-dimethylphenyl)methyl]-4-hydroxy-6,7-dimethylchromen-2-one.
What is the SMILES notation for 3-[(3,4-dimethylphenyl)methyl]-4-hydroxy-6,7-dimethylchromen-2-one?
The canonical SMILES for 3-[(3,4-dimethylphenyl)methyl]-4-hydroxy-6,7-dimethylchromen-2-one is Cc1ccc(Cc2c(O)c3cc(C)c(C)cc3oc2=O)cc1C.
What is the InChIKey of 3-[(3,4-dimethylphenyl)methyl]-4-hydroxy-6,7-dimethylchromen-2-one?
The InChIKey is NHHOOZBYRFKVFW-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H20O3/c1-11-5-6-15(7-12(11)2)10-17-19(21)16-8-13(3)14(4)9-18(16)23-20(17)22/h5-9,21H,10H2,1-4H3.
What are the key properties of 3-[(3,4-dimethylphenyl)methyl]-4-hydroxy-6,7-dimethylchromen-2-one?
3-[(3,4-dimethylphenyl)methyl]-4-hydroxy-6,7-dimethylchromen-2-one has a molecular weight of 308.38 g/mol, XLogP of 4.32, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(3,4-dimethylphenyl)methyl]-4-hydroxy-6,7-dimethylchromen-2-one is sourced from PubChem (CID 54736429), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).