C31H32F2N4O8 — CID 54737515
(4S,4aS,5aS,12aR)-5a-[[(3,5-difluorobenzoyl)amino]methyl]-4,7-bis(dimethylamino)-1,10,11,12a-tetrahydroxy-3,12-dioxo-4,4a,5,6-tetrahydrotetracene-2-carboxamide (PubChem CID 54737515) has the molecular formula C31H32F2N4O8 and a molecular weight of 626.61 g/mol. Its IUPAC name is (4S,4aS,5aS,12aR)-5a-[[(3,5-difluorobenzoyl)amino]methyl]-4,7-bis(dimethylamino)-1,10,11,12a-tetrahydroxy-3,12-dioxo-4,4a,5,6-tetrahydrotetracene-2-carboxamide.
| Compound Name | (4S,4aS,5aS,12aR)-5a-[[(3,5-difluorobenzoyl)amino]methyl]-4,7-bis(dimethylamino)-1,10,11,12a-tetrahydroxy-3,12-dioxo-4,4a,5,6-tetrahydrotetracene-2-carboxamide |
|---|---|
| PubChem CID | 54737515 |
| Molecular Formula | C31H32F2N4O8 |
| Molecular Weight | 626.61 g/mol |
| Exact Mass | 626.22 |
| IUPAC Name | (4S,4aS,5aS,12aR)-5a-[[(3,5-difluorobenzoyl)amino]methyl]-4,7-bis(dimethylamino)-1,10,11,12a-tetrahydroxy-3,12-dioxo-4,4a,5,6-tetrahydrotetracene-2-carboxamide |
| SMILES | CN(C)c1ccc(O)c2c1C[C@@]1(CNC(=O)c3cc(F)cc(F)c3)C[C@H]3[C@H](N(C)C)C(=O)C(C(N)=O)=C(O)[C@@]3(O)C(=O)C1=C2O |
| InChI | InChI=1S/C31H32F2N4O8/c1-36(2)18-5-6-19(38)20-16(18)10-30(12-35-29(44)13-7-14(32)9-15(33)8-13)11-17-23(37(3)4)25(40)21(28(34)43)26(41)31(17,45)27(42)22(30)24(20)39/h5-9,17,23,38-39,41,45H,10-12H2,1-4H3,(H2,34,43)(H,35,44)/t17-,23-,30-,31+/m0/s1 |
| InChIKey | PKSWMQPEEFAPFD-QOLPNDNMSA-N |
| XLogP | 1.11 |
| TPSA | 193.73 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.61 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|