C27H31N5O7 — CID 54737522
(4S,4aS,5aS,12aR)-4,7-bis(dimethylamino)-1,10,11,12a-tetrahydroxy-5a-(imidazol-1-ylmethyl)-3,12-dioxo-4,4a,5,6-tetrahydrotetracene-2-carboxamide (PubChem CID 54737522) has the molecular formula C27H31N5O7 and a molecular weight of 537.57 g/mol. Its IUPAC name is (4S,4aS,5aS,12aR)-4,7-bis(dimethylamino)-1,10,11,12a-tetrahydroxy-5a-(imidazol-1-ylmethyl)-3,12-dioxo-4,4a,5,6-tetrahydrotetracene-2-carboxamide.
| Compound Name | (4S,4aS,5aS,12aR)-4,7-bis(dimethylamino)-1,10,11,12a-tetrahydroxy-5a-(imidazol-1-ylmethyl)-3,12-dioxo-4,4a,5,6-tetrahydrotetracene-2-carboxamide |
|---|---|
| PubChem CID | 54737522 |
| Molecular Formula | C27H31N5O7 |
| Molecular Weight | 537.57 g/mol |
| Exact Mass | 537.22 |
| IUPAC Name | (4S,4aS,5aS,12aR)-4,7-bis(dimethylamino)-1,10,11,12a-tetrahydroxy-5a-(imidazol-1-ylmethyl)-3,12-dioxo-4,4a,5,6-tetrahydrotetracene-2-carboxamide |
| SMILES | CN(C)c1ccc(O)c2c1C[C@@]1(Cn3ccnc3)C[C@H]3[C@H](N(C)C)C(=O)C(C(N)=O)=C(O)[C@@]3(O)C(=O)C1=C2O |
| InChI | InChI=1S/C27H31N5O7/c1-30(2)15-5-6-16(33)17-13(15)9-26(11-32-8-7-29-12-32)10-14-20(31(3)4)22(35)18(25(28)38)23(36)27(14,39)24(37)19(26)21(17)34/h5-8,12,14,20,33-34,36,39H,9-11H2,1-4H3,(H2,28,38)/t14-,20-,26-,27+/m0/s1 |
| InChIKey | XIPSKPQJVPIXBD-RAMMJMJPSA-N |
| XLogP | 0.30 |
| TPSA | 182.45 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.57 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|