C9H4O6 — CID 54737562
4,5-dihydroxycyclohepta[c]furan-1,3,6-trione (PubChem CID 54737562) has the molecular formula C9H4O6 and a molecular weight of 208.12 g/mol. Its IUPAC name is 4,5-dihydroxycyclohepta[c]furan-1,3,6-trione.
| Compound Name | 4,5-dihydroxycyclohepta[c]furan-1,3,6-trione |
|---|---|
| PubChem CID | 54737562 |
| Molecular Formula | C9H4O6 |
| Molecular Weight | 208.12 g/mol |
| Exact Mass | 208.00 |
| IUPAC Name | 4,5-dihydroxycyclohepta[c]furan-1,3,6-trione |
| SMILES | O=C1OC(=O)c2c1ccc(=O)c(O)c2O |
| InChI | InChI=1S/C9H4O6/c10-4-2-1-3-5(7(12)6(4)11)9(14)15-8(3)13/h1-2H,(H2,10,11,12) |
| InChIKey | OSZJNFAETMARAP-UHFFFAOYSA-N |
| XLogP | -0.23 |
| TPSA | 100.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.12 |
| LogP ≤ 5 | -0.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|