About ethyl 1-but-2-ynyl-4-hydroxy-6,7-dimethoxy-2-oxoquinoline-3-carboxylate
ethyl 1-but-2-ynyl-4-hydroxy-6,7-dimethoxy-2-oxoquinoline-3-carboxylate (PubChem CID 54737980) has the molecular formula C18H19NO6
and a molecular weight of 345.35 g/mol. Its IUPAC name is ethyl 1-but-2-ynyl-4-hydroxy-6,7-dimethoxy-2-oxoquinoline-3-carboxylate.
Molecular Properties
| Compound Name | ethyl 1-but-2-ynyl-4-hydroxy-6,7-dimethoxy-2-oxoquinoline-3-carboxylate |
| PubChem CID | 54737980 |
| Molecular Formula | C18H19NO6 |
| Molecular Weight | 345.35 g/mol |
| Exact Mass | 345.12 |
| IUPAC Name | ethyl 1-but-2-ynyl-4-hydroxy-6,7-dimethoxy-2-oxoquinoline-3-carboxylate |
| SMILES | CC#CCn1c(=O)c(C(=O)OCC)c(O)c2cc(OC)c(OC)cc21 |
| InChI | InChI=1S/C18H19NO6/c1-5-7-8-19-12-10-14(24-4)13(23-3)9-11(12)16(20)15(17(19)21)18(22)25-6-2/h9-10,20H,6,8H2,1-4H3 |
| InChIKey | GSQBYWTWHPHICM-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 345.35 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze ethyl 1-but-2-ynyl-4-hydroxy-6,7-dimethoxy-2-oxoquinoline-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 1-but-2-ynyl-4-hydroxy-6,7-dimethoxy-2-oxoquinoline-3-carboxylate?
The IUPAC name of ethyl 1-but-2-ynyl-4-hydroxy-6,7-dimethoxy-2-oxoquinoline-3-carboxylate (CID 54737980) is ethyl 1-but-2-ynyl-4-hydroxy-6,7-dimethoxy-2-oxoquinoline-3-carboxylate.
What is the SMILES notation for ethyl 1-but-2-ynyl-4-hydroxy-6,7-dimethoxy-2-oxoquinoline-3-carboxylate?
The canonical SMILES for ethyl 1-but-2-ynyl-4-hydroxy-6,7-dimethoxy-2-oxoquinoline-3-carboxylate is CC#CCn1c(=O)c(C(=O)OCC)c(O)c2cc(OC)c(OC)cc21.
What is the InChIKey of ethyl 1-but-2-ynyl-4-hydroxy-6,7-dimethoxy-2-oxoquinoline-3-carboxylate?
The InChIKey is GSQBYWTWHPHICM-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H19NO6/c1-5-7-8-19-12-10-14(24-4)13(23-3)9-11(12)16(20)15(17(19)21)18(22)25-6-2/h9-10,20H,6,8H2,1-4H3.
What are the key properties of ethyl 1-but-2-ynyl-4-hydroxy-6,7-dimethoxy-2-oxoquinoline-3-carboxylate?
ethyl 1-but-2-ynyl-4-hydroxy-6,7-dimethoxy-2-oxoquinoline-3-carboxylate has a molecular weight of 345.35 g/mol, XLogP of 1.92, 5 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 1-but-2-ynyl-4-hydroxy-6,7-dimethoxy-2-oxoquinoline-3-carboxylate is sourced from PubChem (CID 54737980), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).