About zinc;but-1-ene;prop-1-ene
zinc;but-1-ene;prop-1-ene (PubChem CID 54738113) has the molecular formula C7H12Zn
and a molecular weight of 161.56 g/mol. Its IUPAC name is zinc;but-1-ene;prop-1-ene.
Molecular Properties
| Compound Name | zinc;but-1-ene;prop-1-ene |
| PubChem CID | 54738113 |
| Molecular Formula | C7H12Zn |
| Molecular Weight | 161.56 g/mol |
| Exact Mass | 160.02 |
| IUPAC Name | zinc;but-1-ene;prop-1-ene |
| SMILES | C=C[CH-]C.C=C[CH2-].[Zn+2] |
| InChI | InChI=1S/C4H7.C3H5.Zn/c1-3-4-2;1-3-2;/h3-4H,1H2,2H3;3H,1-2H2;/q2*-1;+2 |
| InChIKey | PRXMPKLZEGQOJT-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 161.56 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze zinc;but-1-ene;prop-1-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of zinc;but-1-ene;prop-1-ene?
The IUPAC name of zinc;but-1-ene;prop-1-ene (CID 54738113) is zinc;but-1-ene;prop-1-ene.
What is the SMILES notation for zinc;but-1-ene;prop-1-ene?
The canonical SMILES for zinc;but-1-ene;prop-1-ene is C=C[CH-]C.C=C[CH2-].[Zn+2].
What is the InChIKey of zinc;but-1-ene;prop-1-ene?
The InChIKey is PRXMPKLZEGQOJT-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H7.C3H5.Zn/c1-3-4-2;1-3-2;/h3-4H,1H2,2H3;3H,1-2H2;/q2*-1;+2.
What are the key properties of zinc;but-1-ene;prop-1-ene?
zinc;but-1-ene;prop-1-ene has a molecular weight of 161.56 g/mol, XLogP of 2.40, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for zinc;but-1-ene;prop-1-ene is sourced from PubChem (CID 54738113), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).