About (Z)-2,3-dibromoprop-2-en-1-amine
(Z)-2,3-dibromoprop-2-en-1-amine (PubChem CID 5473881) has the molecular formula C3H5Br2N
and a molecular weight of 214.89 g/mol. Its IUPAC name is (Z)-2,3-dibromoprop-2-en-1-amine.
Molecular Properties
| Compound Name | (Z)-2,3-dibromoprop-2-en-1-amine |
| PubChem CID | 5473881 |
| Molecular Formula | C3H5Br2N |
| Molecular Weight | 214.89 g/mol |
| Exact Mass | 212.88 |
| IUPAC Name | (Z)-2,3-dibromoprop-2-en-1-amine |
| SMILES | NC/C(Br)=C/Br |
| InChI | InChI=1S/C3H5Br2N/c4-1-3(5)2-6/h1H,2,6H2/b3-1- |
| InChIKey | MPVYZQSMFBPMSE-IWQZZHSRSA-N |
| XLogP | 1.58 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.89 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (Z)-2,3-dibromoprop-2-en-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-2,3-dibromoprop-2-en-1-amine?
The IUPAC name of (Z)-2,3-dibromoprop-2-en-1-amine (CID 5473881) is (Z)-2,3-dibromoprop-2-en-1-amine.
What is the SMILES notation for (Z)-2,3-dibromoprop-2-en-1-amine?
The canonical SMILES for (Z)-2,3-dibromoprop-2-en-1-amine is NC/C(Br)=C/Br.
What is the InChIKey of (Z)-2,3-dibromoprop-2-en-1-amine?
The InChIKey is MPVYZQSMFBPMSE-IWQZZHSRSA-N. The full InChI is InChI=1S/C3H5Br2N/c4-1-3(5)2-6/h1H,2,6H2/b3-1-.
What are the key properties of (Z)-2,3-dibromoprop-2-en-1-amine?
(Z)-2,3-dibromoprop-2-en-1-amine has a molecular weight of 214.89 g/mol, XLogP of 1.58, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-2,3-dibromoprop-2-en-1-amine is sourced from PubChem (CID 5473881), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).