C26H29FN4O8 — CID 54740221
(4S,4aS,5aR,12aR)-9-[[2-(azetidin-1-yl)acetyl]amino]-4-(dimethylamino)-7-fluoro-1,10,11,12a-tetrahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide (PubChem CID 54740221) has the molecular formula C26H29FN4O8 and a molecular weight of 544.54 g/mol. Its IUPAC name is (4S,4aS,5aR,12aR)-9-[[2-(azetidin-1-yl)acetyl]amino]-4-(dimethylamino)-7-fluoro-1,10,11,12a-tetrahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide.
| Compound Name | (4S,4aS,5aR,12aR)-9-[[2-(azetidin-1-yl)acetyl]amino]-4-(dimethylamino)-7-fluoro-1,10,11,12a-tetrahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
|---|---|
| PubChem CID | 54740221 |
| Molecular Formula | C26H29FN4O8 |
| Molecular Weight | 544.54 g/mol |
| Exact Mass | 544.20 |
| IUPAC Name | (4S,4aS,5aR,12aR)-9-[[2-(azetidin-1-yl)acetyl]amino]-4-(dimethylamino)-7-fluoro-1,10,11,12a-tetrahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
| SMILES | CN(C)[C@@H]1C(=O)C(C(N)=O)=C(O)[C@@]2(O)C(=O)C3=C(O)c4c(O)c(NC(=O)CN5CCC5)cc(F)c4C[C@H]3C[C@@H]12 |
| InChI | InChI=1S/C26H29FN4O8/c1-30(2)19-12-7-10-6-11-13(27)8-14(29-15(32)9-31-4-3-5-31)20(33)17(11)21(34)16(10)23(36)26(12,39)24(37)18(22(19)35)25(28)38/h8,10,12,19,33-34,37,39H,3-7,9H2,1-2H3,(H2,28,38)(H,29,32)/t10-,12-,19-,26-/m0/s1 |
| InChIKey | OTNBMEVDJJMGCV-NXHKEXIGSA-N |
| XLogP | -0.25 |
| TPSA | 193.73 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.54 |
| LogP ≤ 5 | -0.25 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|