C8H4O5-2 — CID 54740357
4-carboxy-6-oxocyclohepta-2,4,7-triene-1,2-diolate (PubChem CID 54740357) has the molecular formula C8H4O5-2 and a molecular weight of 180.11 g/mol. Its IUPAC name is 4-carboxy-6-oxocyclohepta-2,4,7-triene-1,2-diolate.
| Compound Name | 4-carboxy-6-oxocyclohepta-2,4,7-triene-1,2-diolate |
|---|---|
| PubChem CID | 54740357 |
| Molecular Formula | C8H4O5-2 |
| Molecular Weight | 180.11 g/mol |
| Exact Mass | 180.01 |
| IUPAC Name | 4-carboxy-6-oxocyclohepta-2,4,7-triene-1,2-diolate |
| SMILES | O=C(O)c1cc([O-])c([O-])cc(=O)c1 |
| InChI | InChI=1S/C8H6O5/c9-5-1-4(8(12)13)2-6(10)7(11)3-5/h1-3,10-11H,(H,12,13)/p-2 |
| InChIKey | ZGKNMKBZOSTFCB-UHFFFAOYSA-L |
| XLogP | -1.11 |
| TPSA | 100.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.11 |
| LogP ≤ 5 | -1.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |