C26H26FN5O8 — CID 54741254
N-[(5aR,6aS,7S,10aR)-9-carbamoyl-7-(dimethylamino)-4-fluoro-1,10,10a,12-tetrahydroxy-8,11-dioxo-5a,6,6a,7-tetrahydro-5H-tetracen-2-yl]-1-methylpyrazole-3-carboxamide (PubChem CID 54741254) has the molecular formula C26H26FN5O8 and a molecular weight of 555.52 g/mol. Its IUPAC name is N-[(5aR,6aS,7S,10aR)-9-carbamoyl-7-(dimethylamino)-4-fluoro-1,10,10a,12-tetrahydroxy-8,11-dioxo-5a,6,6a,7-tetrahydro-5H-tetracen-2-yl]-1-methylpyrazole-3-carboxamide.
| Compound Name | N-[(5aR,6aS,7S,10aR)-9-carbamoyl-7-(dimethylamino)-4-fluoro-1,10,10a,12-tetrahydroxy-8,11-dioxo-5a,6,6a,7-tetrahydro-5H-tetracen-2-yl]-1-methylpyrazole-3-carboxamide |
|---|---|
| PubChem CID | 54741254 |
| Molecular Formula | C26H26FN5O8 |
| Molecular Weight | 555.52 g/mol |
| Exact Mass | 555.18 |
| IUPAC Name | N-[(5aR,6aS,7S,10aR)-9-carbamoyl-7-(dimethylamino)-4-fluoro-1,10,10a,12-tetrahydroxy-8,11-dioxo-5a,6,6a,7-tetrahydro-5H-tetracen-2-yl]-1-methylpyrazole-3-carboxamide |
| SMILES | CN(C)[C@@H]1C(=O)C(C(N)=O)=C(O)[C@@]2(O)C(=O)C3=C(O)c4c(O)c(NC(=O)c5ccn(C)n5)cc(F)c4C[C@H]3C[C@@H]12 |
| InChI | InChI=1S/C26H26FN5O8/c1-31(2)18-11-7-9-6-10-12(27)8-14(29-25(39)13-4-5-32(3)30-13)19(33)16(10)20(34)15(9)22(36)26(11,40)23(37)17(21(18)35)24(28)38/h4-5,8-9,11,18,33-34,37,40H,6-7H2,1-3H3,(H2,28,38)(H,29,39)/t9-,11-,18-,26-/m0/s1 |
| InChIKey | JXIPOSRDVUZKLM-FEBLPKDSSA-N |
| XLogP | 0.09 |
| TPSA | 208.31 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.52 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|