C28H33FN4O8 — CID 54741259
(2S)-N-[(5aR,6aS,7S,10aR)-9-carbamoyl-7-(dimethylamino)-4-fluoro-1,10,10a,12-tetrahydroxy-8,11-dioxo-5a,6,6a,7-tetrahydro-5H-tetracen-2-yl]-1-methylpiperidine-2-carboxamide (PubChem CID 54741259) has the molecular formula C28H33FN4O8 and a molecular weight of 572.59 g/mol. Its IUPAC name is (2S)-N-[(5aR,6aS,7S,10aR)-9-carbamoyl-7-(dimethylamino)-4-fluoro-1,10,10a,12-tetrahydroxy-8,11-dioxo-5a,6,6a,7-tetrahydro-5H-tetracen-2-yl]-1-methylpiperidine-2-carboxamide.
| Compound Name | (2S)-N-[(5aR,6aS,7S,10aR)-9-carbamoyl-7-(dimethylamino)-4-fluoro-1,10,10a,12-tetrahydroxy-8,11-dioxo-5a,6,6a,7-tetrahydro-5H-tetracen-2-yl]-1-methylpiperidine-2-carboxamide |
|---|---|
| PubChem CID | 54741259 |
| Molecular Formula | C28H33FN4O8 |
| Molecular Weight | 572.59 g/mol |
| Exact Mass | 572.23 |
| IUPAC Name | (2S)-N-[(5aR,6aS,7S,10aR)-9-carbamoyl-7-(dimethylamino)-4-fluoro-1,10,10a,12-tetrahydroxy-8,11-dioxo-5a,6,6a,7-tetrahydro-5H-tetracen-2-yl]-1-methylpiperidine-2-carboxamide |
| SMILES | CN(C)[C@@H]1C(=O)C(C(N)=O)=C(O)[C@@]2(O)C(=O)C3=C(O)c4c(O)c(NC(=O)[C@@H]5CCCCN5C)cc(F)c4C[C@H]3C[C@@H]12 |
| InChI | InChI=1S/C28H33FN4O8/c1-32(2)20-13-9-11-8-12-14(29)10-15(31-27(40)16-6-4-5-7-33(16)3)21(34)18(12)22(35)17(11)24(37)28(13,41)25(38)19(23(20)36)26(30)39/h10-11,13,16,20,34-35,38,41H,4-9H2,1-3H3,(H2,30,39)(H,31,40)/t11-,13-,16-,20-,28-/m0/s1 |
| InChIKey | WWVYZSSUYDYGBJ-CQBHUNIESA-N |
| XLogP | 0.53 |
| TPSA | 193.73 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.59 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|