C28H36N4O8 — CID 54741514
(4S,4aS,5aR,12aR)-4,7-bis(dimethylamino)-9-[(2E)-2-ethoxyiminopropyl]-1,10,11,12a-tetrahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide (PubChem CID 54741514) has the molecular formula C28H36N4O8 and a molecular weight of 556.62 g/mol. Its IUPAC name is (4S,4aS,5aR,12aR)-4,7-bis(dimethylamino)-9-[(2E)-2-ethoxyiminopropyl]-1,10,11,12a-tetrahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide.
| Compound Name | (4S,4aS,5aR,12aR)-4,7-bis(dimethylamino)-9-[(2E)-2-ethoxyiminopropyl]-1,10,11,12a-tetrahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
|---|---|
| PubChem CID | 54741514 |
| Molecular Formula | C28H36N4O8 |
| Molecular Weight | 556.62 g/mol |
| Exact Mass | 556.25 |
| IUPAC Name | (4S,4aS,5aR,12aR)-4,7-bis(dimethylamino)-9-[(2E)-2-ethoxyiminopropyl]-1,10,11,12a-tetrahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
| SMILES | CCO/N=C(\C)Cc1cc(N(C)C)c2c(c1O)C(O)=C1C(=O)[C@]3(O)C(O)=C(C(N)=O)C(=O)[C@@H](N(C)C)[C@@H]3C[C@@H]1C2 |
| InChI | InChI=1S/C28H36N4O8/c1-7-40-30-12(2)8-14-11-17(31(3)4)15-9-13-10-16-21(32(5)6)24(35)20(27(29)38)26(37)28(16,39)25(36)18(13)23(34)19(15)22(14)33/h11,13,16,21,33-34,37,39H,7-10H2,1-6H3,(H2,29,38)/b30-12+/t13-,16-,21-,28-/m0/s1 |
| InChIKey | UYTYRWHTAXPMJP-NZDMCTFQSA-N |
| XLogP | 0.98 |
| TPSA | 186.22 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.62 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|