About diethyl 2-[[2-(1,2-dihydroxyethyl)-3-hydroxy-5-oxo-2H-furan-4-yl]oxycarbonylamino]pentanedioate
diethyl 2-[[2-(1,2-dihydroxyethyl)-3-hydroxy-5-oxo-2H-furan-4-yl]oxycarbonylamino]pentanedioate (PubChem CID 54741800) has the molecular formula C16H23NO11
and a molecular weight of 405.36 g/mol. Its IUPAC name is diethyl 2-[[2-(1,2-dihydroxyethyl)-3-hydroxy-5-oxo-2H-furan-4-yl]oxycarbonylamino]pentanedioate.
Molecular Properties
| Compound Name | diethyl 2-[[2-(1,2-dihydroxyethyl)-3-hydroxy-5-oxo-2H-furan-4-yl]oxycarbonylamino]pentanedioate |
| PubChem CID | 54741800 |
| Molecular Formula | C16H23NO11 |
| Molecular Weight | 405.36 g/mol |
| Exact Mass | 405.13 |
| IUPAC Name | diethyl 2-[[2-(1,2-dihydroxyethyl)-3-hydroxy-5-oxo-2H-furan-4-yl]oxycarbonylamino]pentanedioate |
| SMILES | CCOC(=O)CCC(NC(=O)OC1=C(O)C(C(O)CO)OC1=O)C(=O)OCC |
| InChI | InChI=1S/C16H23NO11/c1-3-25-10(20)6-5-8(14(22)26-4-2)17-16(24)28-13-11(21)12(9(19)7-18)27-15(13)23/h8-9,12,18-19,21H,3-7H2,1-2H3,(H,17,24) |
| InChIKey | RZALBKREMMIUMH-UHFFFAOYSA-N |
| XLogP | -0.96 |
| TPSA | 177.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 405.36 |
| LogP ≤ 5 | -0.96 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|
Analyze diethyl 2-[[2-(1,2-dihydroxyethyl)-3-hydroxy-5-oxo-2H-furan-4-yl]oxycarbonylamino]pentanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of diethyl 2-[[2-(1,2-dihydroxyethyl)-3-hydroxy-5-oxo-2H-furan-4-yl]oxycarbonylamino]pentanedioate?
The IUPAC name of diethyl 2-[[2-(1,2-dihydroxyethyl)-3-hydroxy-5-oxo-2H-furan-4-yl]oxycarbonylamino]pentanedioate (CID 54741800) is diethyl 2-[[2-(1,2-dihydroxyethyl)-3-hydroxy-5-oxo-2H-furan-4-yl]oxycarbonylamino]pentanedioate.
What is the SMILES notation for diethyl 2-[[2-(1,2-dihydroxyethyl)-3-hydroxy-5-oxo-2H-furan-4-yl]oxycarbonylamino]pentanedioate?
The canonical SMILES for diethyl 2-[[2-(1,2-dihydroxyethyl)-3-hydroxy-5-oxo-2H-furan-4-yl]oxycarbonylamino]pentanedioate is CCOC(=O)CCC(NC(=O)OC1=C(O)C(C(O)CO)OC1=O)C(=O)OCC.
What is the InChIKey of diethyl 2-[[2-(1,2-dihydroxyethyl)-3-hydroxy-5-oxo-2H-furan-4-yl]oxycarbonylamino]pentanedioate?
The InChIKey is RZALBKREMMIUMH-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H23NO11/c1-3-25-10(20)6-5-8(14(22)26-4-2)17-16(24)28-13-11(21)12(9(19)7-18)27-15(13)23/h8-9,12,18-19,21H,3-7H2,1-2H3,(H,17,24).
What are the key properties of diethyl 2-[[2-(1,2-dihydroxyethyl)-3-hydroxy-5-oxo-2H-furan-4-yl]oxycarbonylamino]pentanedioate?
diethyl 2-[[2-(1,2-dihydroxyethyl)-3-hydroxy-5-oxo-2H-furan-4-yl]oxycarbonylamino]pentanedioate has a molecular weight of 405.36 g/mol, XLogP of -0.96, 10 rotatable bonds, 4 hydrogen bond donors, and 11 hydrogen bond acceptors.
Where does this data come from?
All data for diethyl 2-[[2-(1,2-dihydroxyethyl)-3-hydroxy-5-oxo-2H-furan-4-yl]oxycarbonylamino]pentanedioate is sourced from PubChem (CID 54741800), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).