C10H22N2 — CID 547422
2,3-dimethyl-5-(2-methylpropyl)piperazine (PubChem CID 547422) has the molecular formula C10H22N2 and a molecular weight of 170.30 g/mol. Its IUPAC name is 2,3-dimethyl-5-(2-methylpropyl)piperazine.
| Compound Name | 2,3-dimethyl-5-(2-methylpropyl)piperazine |
|---|---|
| PubChem CID | 547422 |
| Molecular Formula | C10H22N2 |
| Molecular Weight | 170.30 g/mol |
| Exact Mass | 170.18 |
| IUPAC Name | 2,3-dimethyl-5-(2-methylpropyl)piperazine |
| SMILES | CC(C)CC1CNC(C)C(C)N1 |
| InChI | InChI=1S/C10H22N2/c1-7(2)5-10-6-11-8(3)9(4)12-10/h7-12H,5-6H2,1-4H3 |
| InChIKey | QGBRAICPMFRKKN-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.30 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |