C30H60N6 — CID 547437
1,3,5-tris(2,2,6,6-tetramethylpiperidin-4-yl)-1,3,5-triazinane (PubChem CID 547437) has the molecular formula C30H60N6 and a molecular weight of 504.85 g/mol. Its IUPAC name is 1,3,5-tris(2,2,6,6-tetramethylpiperidin-4-yl)-1,3,5-triazinane.
| Compound Name | 1,3,5-tris(2,2,6,6-tetramethylpiperidin-4-yl)-1,3,5-triazinane |
|---|---|
| PubChem CID | 547437 |
| Molecular Formula | C30H60N6 |
| Molecular Weight | 504.85 g/mol |
| Exact Mass | 504.49 |
| IUPAC Name | 1,3,5-tris(2,2,6,6-tetramethylpiperidin-4-yl)-1,3,5-triazinane |
| SMILES | CC1(C)CC(N2CN(C3CC(C)(C)NC(C)(C)C3)CN(C3CC(C)(C)NC(C)(C)C3)C2)CC(C)(C)N1 |
| InChI | InChI=1S/C30H60N6/c1-25(2)13-22(14-26(3,4)31-25)34-19-35(23-15-27(5,6)32-28(7,8)16-23)21-36(20-34)24-17-29(9,10)33-30(11,12)18-24/h22-24,31-33H,13-21H2,1-12H3 |
| InChIKey | XHQJBVUCGLYKNR-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 45.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.85 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |