About ethyl 4-hydroxy-5-oxo-1,2-dihydropyrrole-3-carboxylate
ethyl 4-hydroxy-5-oxo-1,2-dihydropyrrole-3-carboxylate (PubChem CID 54744027) has the molecular formula C7H9NO4
and a molecular weight of 171.15 g/mol. Its IUPAC name is ethyl 4-hydroxy-5-oxo-1,2-dihydropyrrole-3-carboxylate.
Molecular Properties
| Compound Name | ethyl 4-hydroxy-5-oxo-1,2-dihydropyrrole-3-carboxylate |
| PubChem CID | 54744027 |
| Molecular Formula | C7H9NO4 |
| Molecular Weight | 171.15 g/mol |
| Exact Mass | 171.05 |
| IUPAC Name | ethyl 4-hydroxy-5-oxo-1,2-dihydropyrrole-3-carboxylate |
| SMILES | CCOC(=O)C1=C(O)C(=O)NC1 |
| InChI | InChI=1S/C7H9NO4/c1-2-12-7(11)4-3-8-6(10)5(4)9/h9H,2-3H2,1H3,(H,8,10) |
| InChIKey | ICNJPXDFKBXHBX-UHFFFAOYSA-N |
| XLogP | -0.51 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 171.15 |
| LogP ≤ 5 | -0.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze ethyl 4-hydroxy-5-oxo-1,2-dihydropyrrole-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 4-hydroxy-5-oxo-1,2-dihydropyrrole-3-carboxylate?
The IUPAC name of ethyl 4-hydroxy-5-oxo-1,2-dihydropyrrole-3-carboxylate (CID 54744027) is ethyl 4-hydroxy-5-oxo-1,2-dihydropyrrole-3-carboxylate.
What is the SMILES notation for ethyl 4-hydroxy-5-oxo-1,2-dihydropyrrole-3-carboxylate?
The canonical SMILES for ethyl 4-hydroxy-5-oxo-1,2-dihydropyrrole-3-carboxylate is CCOC(=O)C1=C(O)C(=O)NC1.
What is the InChIKey of ethyl 4-hydroxy-5-oxo-1,2-dihydropyrrole-3-carboxylate?
The InChIKey is ICNJPXDFKBXHBX-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9NO4/c1-2-12-7(11)4-3-8-6(10)5(4)9/h9H,2-3H2,1H3,(H,8,10).
What are the key properties of ethyl 4-hydroxy-5-oxo-1,2-dihydropyrrole-3-carboxylate?
ethyl 4-hydroxy-5-oxo-1,2-dihydropyrrole-3-carboxylate has a molecular weight of 171.15 g/mol, XLogP of -0.51, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 4-hydroxy-5-oxo-1,2-dihydropyrrole-3-carboxylate is sourced from PubChem (CID 54744027), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).