C12H16O14 — CID 54744158
(1S,2S)-2-hydroxy-1-[(Z,4R,5S)-2,3,4,5,6-pentahydroxyhex-2-enoyl]oxypropane-1,2,3-tricarboxylic acid (PubChem CID 54744158) has the molecular formula C12H16O14 and a molecular weight of 384.25 g/mol. Its IUPAC name is (1S,2S)-2-hydroxy-1-[(Z,4R,5S)-2,3,4,5,6-pentahydroxyhex-2-enoyl]oxypropane-1,2,3-tricarboxylic acid.
| Compound Name | (1S,2S)-2-hydroxy-1-[(Z,4R,5S)-2,3,4,5,6-pentahydroxyhex-2-enoyl]oxypropane-1,2,3-tricarboxylic acid |
|---|---|
| PubChem CID | 54744158 |
| Molecular Formula | C12H16O14 |
| Molecular Weight | 384.25 g/mol |
| Exact Mass | 384.05 |
| IUPAC Name | (1S,2S)-2-hydroxy-1-[(Z,4R,5S)-2,3,4,5,6-pentahydroxyhex-2-enoyl]oxypropane-1,2,3-tricarboxylic acid |
| SMILES | O=C(O)C[C@@](O)(C(=O)O)[C@H](OC(=O)/C(O)=C(/O)[C@H](O)[C@@H](O)CO)C(=O)O |
| InChI | InChI=1S/C12H16O14/c13-2-3(14)5(17)6(18)7(19)10(22)26-8(9(20)21)12(25,11(23)24)1-4(15)16/h3,5,8,13-14,17-19,25H,1-2H2,(H,15,16)(H,20,21)(H,23,24)/b7-6-/t3-,5+,8+,12-/m0/s1 |
| InChIKey | JDYQFTCVIYZGCF-JYCRNBNFSA-N |
| XLogP | -3.69 |
| TPSA | 259.58 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.25 |
| LogP ≤ 5 | -3.69 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|