About 2-[(E)-2-(2,5-dimethoxyphenyl)ethenyl]-3-methyl-1,3-benzothiazol-3-ium
2-[(E)-2-(2,5-dimethoxyphenyl)ethenyl]-3-methyl-1,3-benzothiazol-3-ium (PubChem CID 5474577) has the molecular formula C18H18NO2S+
and a molecular weight of 312.41 g/mol. Its IUPAC name is 2-[(E)-2-(2,5-dimethoxyphenyl)ethenyl]-3-methyl-1,3-benzothiazol-3-ium.
Molecular Properties
| Compound Name | 2-[(E)-2-(2,5-dimethoxyphenyl)ethenyl]-3-methyl-1,3-benzothiazol-3-ium |
| PubChem CID | 5474577 |
| Molecular Formula | C18H18NO2S+ |
| Molecular Weight | 312.41 g/mol |
| Exact Mass | 312.11 |
| IUPAC Name | 2-[(E)-2-(2,5-dimethoxyphenyl)ethenyl]-3-methyl-1,3-benzothiazol-3-ium |
| SMILES | COc1ccc(OC)c(/C=C/c2sc3ccccc3[n+]2C)c1 |
| InChI | InChI=1S/C18H18NO2S/c1-19-15-6-4-5-7-17(15)22-18(19)11-8-13-12-14(20-2)9-10-16(13)21-3/h4-12H,1-3H3/q+1/b11-8+ |
| InChIKey | AJYDVCNKVYLAFH-DHZHZOJOSA-N |
| XLogP | 3.91 |
| TPSA | 22.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 312.41 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 2-[(E)-2-(2,5-dimethoxyphenyl)ethenyl]-3-methyl-1,3-benzothiazol-3-ium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(E)-2-(2,5-dimethoxyphenyl)ethenyl]-3-methyl-1,3-benzothiazol-3-ium?
The IUPAC name of 2-[(E)-2-(2,5-dimethoxyphenyl)ethenyl]-3-methyl-1,3-benzothiazol-3-ium (CID 5474577) is 2-[(E)-2-(2,5-dimethoxyphenyl)ethenyl]-3-methyl-1,3-benzothiazol-3-ium.
What is the SMILES notation for 2-[(E)-2-(2,5-dimethoxyphenyl)ethenyl]-3-methyl-1,3-benzothiazol-3-ium?
The canonical SMILES for 2-[(E)-2-(2,5-dimethoxyphenyl)ethenyl]-3-methyl-1,3-benzothiazol-3-ium is COc1ccc(OC)c(/C=C/c2sc3ccccc3[n+]2C)c1.
What is the InChIKey of 2-[(E)-2-(2,5-dimethoxyphenyl)ethenyl]-3-methyl-1,3-benzothiazol-3-ium?
The InChIKey is AJYDVCNKVYLAFH-DHZHZOJOSA-N. The full InChI is InChI=1S/C18H18NO2S/c1-19-15-6-4-5-7-17(15)22-18(19)11-8-13-12-14(20-2)9-10-16(13)21-3/h4-12H,1-3H3/q+1/b11-8+.
What are the key properties of 2-[(E)-2-(2,5-dimethoxyphenyl)ethenyl]-3-methyl-1,3-benzothiazol-3-ium?
2-[(E)-2-(2,5-dimethoxyphenyl)ethenyl]-3-methyl-1,3-benzothiazol-3-ium has a molecular weight of 312.41 g/mol, XLogP of 3.91, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(E)-2-(2,5-dimethoxyphenyl)ethenyl]-3-methyl-1,3-benzothiazol-3-ium is sourced from PubChem (CID 5474577), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).