C11H16O3 — CID 54746323
4-hydroxy-6,7-dimethyl-4a,5,6,7,8,8a-hexahydrochromen-2-one (PubChem CID 54746323) has the molecular formula C11H16O3 and a molecular weight of 196.25 g/mol. Its IUPAC name is 4-hydroxy-6,7-dimethyl-4a,5,6,7,8,8a-hexahydrochromen-2-one.
| Compound Name | 4-hydroxy-6,7-dimethyl-4a,5,6,7,8,8a-hexahydrochromen-2-one |
|---|---|
| PubChem CID | 54746323 |
| Molecular Formula | C11H16O3 |
| Molecular Weight | 196.25 g/mol |
| Exact Mass | 196.11 |
| IUPAC Name | 4-hydroxy-6,7-dimethyl-4a,5,6,7,8,8a-hexahydrochromen-2-one |
| SMILES | CC1CC2OC(=O)C=C(O)C2CC1C |
| InChI | InChI=1S/C11H16O3/c1-6-3-8-9(12)5-11(13)14-10(8)4-7(6)2/h5-8,10,12H,3-4H2,1-2H3 |
| InChIKey | LKJIYUKAFZIAPX-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.25 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |