C19H18N4O2S — CID 54746636
4-hydroxy-1-methyl-3-[(3S)-3-methyl-4-phenyl-5-sulfanylidene-1,2,4-triazolidin-3-yl]quinolin-2-one (PubChem CID 54746636) has the molecular formula C19H18N4O2S and a molecular weight of 366.45 g/mol. Its IUPAC name is 4-hydroxy-1-methyl-3-[(3S)-3-methyl-4-phenyl-5-sulfanylidene-1,2,4-triazolidin-3-yl]quinolin-2-one.
| Compound Name | 4-hydroxy-1-methyl-3-[(3S)-3-methyl-4-phenyl-5-sulfanylidene-1,2,4-triazolidin-3-yl]quinolin-2-one |
|---|---|
| PubChem CID | 54746636 |
| Molecular Formula | C19H18N4O2S |
| Molecular Weight | 366.45 g/mol |
| Exact Mass | 366.12 |
| IUPAC Name | 4-hydroxy-1-methyl-3-[(3S)-3-methyl-4-phenyl-5-sulfanylidene-1,2,4-triazolidin-3-yl]quinolin-2-one |
| SMILES | Cn1c(=O)c([C@]2(C)NNC(=S)N2c2ccccc2)c(O)c2ccccc21 |
| InChI | InChI=1S/C19H18N4O2S/c1-19(21-20-18(26)23(19)12-8-4-3-5-9-12)15-16(24)13-10-6-7-11-14(13)22(2)17(15)25/h3-11,21,24H,1-2H3,(H,20,26)/t19-/m1/s1 |
| InChIKey | JFCBHQOTWJRLFP-LJQANCHMSA-N |
| XLogP | 2.32 |
| TPSA | 69.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.45 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|