About 3-[2-chloro-3-(4-fluorophenyl)-4-hydroxy-6-oxo-7H-thieno[2,3-b]pyridin-5-yl]benzoic acid
3-[2-chloro-3-(4-fluorophenyl)-4-hydroxy-6-oxo-7H-thieno[2,3-b]pyridin-5-yl]benzoic acid (PubChem CID 54747294) has the molecular formula C20H11ClFNO4S
and a molecular weight of 415.83 g/mol. Its IUPAC name is 3-[2-chloro-3-(4-fluorophenyl)-4-hydroxy-6-oxo-7H-thieno[2,3-b]pyridin-5-yl]benzoic acid.
Molecular Properties
| Compound Name | 3-[2-chloro-3-(4-fluorophenyl)-4-hydroxy-6-oxo-7H-thieno[2,3-b]pyridin-5-yl]benzoic acid |
| PubChem CID | 54747294 |
| Molecular Formula | C20H11ClFNO4S |
| Molecular Weight | 415.83 g/mol |
| Exact Mass | 415.01 |
| IUPAC Name | 3-[2-chloro-3-(4-fluorophenyl)-4-hydroxy-6-oxo-7H-thieno[2,3-b]pyridin-5-yl]benzoic acid |
| SMILES | O=C(O)c1cccc(-c2c(O)c3c(-c4ccc(F)cc4)c(Cl)sc3[nH]c2=O)c1 |
| InChI | InChI=1S/C20H11ClFNO4S/c21-17-13(9-4-6-12(22)7-5-9)15-16(24)14(18(25)23-19(15)28-17)10-2-1-3-11(8-10)20(26)27/h1-8H,(H,26,27)(H2,23,24,25) |
| InChIKey | YACKCEDKPNJAIA-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 90.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 415.83 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-[2-chloro-3-(4-fluorophenyl)-4-hydroxy-6-oxo-7H-thieno[2,3-b]pyridin-5-yl]benzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[2-chloro-3-(4-fluorophenyl)-4-hydroxy-6-oxo-7H-thieno[2,3-b]pyridin-5-yl]benzoic acid?
The IUPAC name of 3-[2-chloro-3-(4-fluorophenyl)-4-hydroxy-6-oxo-7H-thieno[2,3-b]pyridin-5-yl]benzoic acid (CID 54747294) is 3-[2-chloro-3-(4-fluorophenyl)-4-hydroxy-6-oxo-7H-thieno[2,3-b]pyridin-5-yl]benzoic acid.
What is the SMILES notation for 3-[2-chloro-3-(4-fluorophenyl)-4-hydroxy-6-oxo-7H-thieno[2,3-b]pyridin-5-yl]benzoic acid?
The canonical SMILES for 3-[2-chloro-3-(4-fluorophenyl)-4-hydroxy-6-oxo-7H-thieno[2,3-b]pyridin-5-yl]benzoic acid is O=C(O)c1cccc(-c2c(O)c3c(-c4ccc(F)cc4)c(Cl)sc3[nH]c2=O)c1.
What is the InChIKey of 3-[2-chloro-3-(4-fluorophenyl)-4-hydroxy-6-oxo-7H-thieno[2,3-b]pyridin-5-yl]benzoic acid?
The InChIKey is YACKCEDKPNJAIA-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H11ClFNO4S/c21-17-13(9-4-6-12(22)7-5-9)15-16(24)14(18(25)23-19(15)28-17)10-2-1-3-11(8-10)20(26)27/h1-8H,(H,26,27)(H2,23,24,25).
What are the key properties of 3-[2-chloro-3-(4-fluorophenyl)-4-hydroxy-6-oxo-7H-thieno[2,3-b]pyridin-5-yl]benzoic acid?
3-[2-chloro-3-(4-fluorophenyl)-4-hydroxy-6-oxo-7H-thieno[2,3-b]pyridin-5-yl]benzoic acid has a molecular weight of 415.83 g/mol, XLogP of 5.12, 3 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[2-chloro-3-(4-fluorophenyl)-4-hydroxy-6-oxo-7H-thieno[2,3-b]pyridin-5-yl]benzoic acid is sourced from PubChem (CID 54747294), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).