C28H37N5O8 — CID 54748536
(4S,12aR)-4,7-bis(dimethylamino)-9-[2-(2,2-dimethylpropanoyl)hydrazinyl]-1,10,11,12a-tetrahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide (PubChem CID 54748536) has the molecular formula C28H37N5O8 and a molecular weight of 571.63 g/mol. Its IUPAC name is (4S,12aR)-4,7-bis(dimethylamino)-9-[2-(2,2-dimethylpropanoyl)hydrazinyl]-1,10,11,12a-tetrahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide.
| Compound Name | (4S,12aR)-4,7-bis(dimethylamino)-9-[2-(2,2-dimethylpropanoyl)hydrazinyl]-1,10,11,12a-tetrahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
|---|---|
| PubChem CID | 54748536 |
| Molecular Formula | C28H37N5O8 |
| Molecular Weight | 571.63 g/mol |
| Exact Mass | 571.26 |
| IUPAC Name | (4S,12aR)-4,7-bis(dimethylamino)-9-[2-(2,2-dimethylpropanoyl)hydrazinyl]-1,10,11,12a-tetrahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
| SMILES | CN(C)c1cc(NNC(=O)C(C)(C)C)c(O)c2c1CC1CC3[C@H](N(C)C)C(=O)C(C(N)=O)=C(O)[C@@]3(O)C(=O)C1=C2O |
| InChI | InChI=1S/C28H37N5O8/c1-27(2,3)26(40)31-30-14-10-15(32(4)5)12-8-11-9-13-19(33(6)7)22(36)18(25(29)39)24(38)28(13,41)23(37)16(11)21(35)17(12)20(14)34/h10-11,13,19,30,34-35,38,41H,8-9H2,1-7H3,(H2,29,39)(H,31,40)/t11?,13?,19-,28-/m0/s1 |
| InChIKey | GTYSDNLXTBKDMZ-QGGZCICFSA-N |
| XLogP | 0.52 |
| TPSA | 205.76 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.63 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|