C19H17FN4O3 — CID 54748776
6-[(4-fluorophenyl)methyl]-10-hydroxy-N-methyl-12-oxo-1,4,8-triazatricyclo[7.3.1.05,13]trideca-5(13),6,8,10-tetraene-11-carboxamide (PubChem CID 54748776) has the molecular formula C19H17FN4O3 and a molecular weight of 368.37 g/mol. Its IUPAC name is 6-[(4-fluorophenyl)methyl]-10-hydroxy-N-methyl-12-oxo-1,4,8-triazatricyclo[7.3.1.05,13]trideca-5(13),6,8,10-tetraene-11-carboxamide.
| Compound Name | 6-[(4-fluorophenyl)methyl]-10-hydroxy-N-methyl-12-oxo-1,4,8-triazatricyclo[7.3.1.05,13]trideca-5(13),6,8,10-tetraene-11-carboxamide |
|---|---|
| PubChem CID | 54748776 |
| Molecular Formula | C19H17FN4O3 |
| Molecular Weight | 368.37 g/mol |
| Exact Mass | 368.13 |
| IUPAC Name | 6-[(4-fluorophenyl)methyl]-10-hydroxy-N-methyl-12-oxo-1,4,8-triazatricyclo[7.3.1.05,13]trideca-5(13),6,8,10-tetraene-11-carboxamide |
| SMILES | CNC(=O)c1c(O)c2ncc(Cc3ccc(F)cc3)c3c2n(c1=O)CCN3 |
| InChI | InChI=1S/C19H17FN4O3/c1-21-18(26)13-17(25)15-16-14(22-6-7-24(16)19(13)27)11(9-23-15)8-10-2-4-12(20)5-3-10/h2-5,9,22,25H,6-8H2,1H3,(H,21,26) |
| InChIKey | KRZCUKDVNMTGSS-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 96.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.37 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |