C22H23FN4O4 — CID 54748778
N-(2-ethoxyethyl)-6-[(4-fluorophenyl)methyl]-10-hydroxy-12-oxo-1,4,8-triazatricyclo[7.3.1.05,13]trideca-5(13),6,8,10-tetraene-11-carboxamide (PubChem CID 54748778) has the molecular formula C22H23FN4O4 and a molecular weight of 426.45 g/mol. Its IUPAC name is N-(2-ethoxyethyl)-6-[(4-fluorophenyl)methyl]-10-hydroxy-12-oxo-1,4,8-triazatricyclo[7.3.1.05,13]trideca-5(13),6,8,10-tetraene-11-carboxamide.
| Compound Name | N-(2-ethoxyethyl)-6-[(4-fluorophenyl)methyl]-10-hydroxy-12-oxo-1,4,8-triazatricyclo[7.3.1.05,13]trideca-5(13),6,8,10-tetraene-11-carboxamide |
|---|---|
| PubChem CID | 54748778 |
| Molecular Formula | C22H23FN4O4 |
| Molecular Weight | 426.45 g/mol |
| Exact Mass | 426.17 |
| IUPAC Name | N-(2-ethoxyethyl)-6-[(4-fluorophenyl)methyl]-10-hydroxy-12-oxo-1,4,8-triazatricyclo[7.3.1.05,13]trideca-5(13),6,8,10-tetraene-11-carboxamide |
| SMILES | CCOCCNC(=O)c1c(O)c2ncc(Cc3ccc(F)cc3)c3c2n(c1=O)CCN3 |
| InChI | InChI=1S/C22H23FN4O4/c1-2-31-10-8-25-21(29)16-20(28)18-19-17(24-7-9-27(19)22(16)30)14(12-26-18)11-13-3-5-15(23)6-4-13/h3-6,12,24,28H,2,7-11H2,1H3,(H,25,29) |
| InChIKey | VMKUBYALRJRWOO-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 105.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.45 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|