C21H21FN4O4 — CID 54748781
8-[(4-fluorophenyl)methyl]-4-hydroxy-N-(2-hydroxyethyl)-2-oxo-1,6,10-triazatricyclo[7.4.1.05,14]tetradeca-3,5,7,9(14)-tetraene-3-carboxamide (PubChem CID 54748781) has the molecular formula C21H21FN4O4 and a molecular weight of 412.42 g/mol. Its IUPAC name is 8-[(4-fluorophenyl)methyl]-4-hydroxy-N-(2-hydroxyethyl)-2-oxo-1,6,10-triazatricyclo[7.4.1.05,14]tetradeca-3,5,7,9(14)-tetraene-3-carboxamide.
| Compound Name | 8-[(4-fluorophenyl)methyl]-4-hydroxy-N-(2-hydroxyethyl)-2-oxo-1,6,10-triazatricyclo[7.4.1.05,14]tetradeca-3,5,7,9(14)-tetraene-3-carboxamide |
|---|---|
| PubChem CID | 54748781 |
| Molecular Formula | C21H21FN4O4 |
| Molecular Weight | 412.42 g/mol |
| Exact Mass | 412.15 |
| IUPAC Name | 8-[(4-fluorophenyl)methyl]-4-hydroxy-N-(2-hydroxyethyl)-2-oxo-1,6,10-triazatricyclo[7.4.1.05,14]tetradeca-3,5,7,9(14)-tetraene-3-carboxamide |
| SMILES | O=C(NCCO)c1c(O)c2ncc(Cc3ccc(F)cc3)c3c2n(c1=O)CCCN3 |
| InChI | InChI=1S/C21H21FN4O4/c22-14-4-2-12(3-5-14)10-13-11-25-17-18-16(13)23-6-1-8-26(18)21(30)15(19(17)28)20(29)24-7-9-27/h2-5,11,23,27-28H,1,6-10H2,(H,24,29) |
| InChIKey | ODFHRZKMYCVWBL-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 116.48 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.42 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |