C22H22FN3O6 — CID 54748800
6-[(4-fluorophenyl)methyl]-10-hydroxy-3-(hydroxymethyl)-N-(2-methoxyethyl)-12-oxo-4-oxa-1,8-diazatricyclo[7.3.1.05,13]trideca-5(13),6,8,10-tetraene-11-carboxamide (PubChem CID 54748800) has the molecular formula C22H22FN3O6 and a molecular weight of 443.43 g/mol. Its IUPAC name is 6-[(4-fluorophenyl)methyl]-10-hydroxy-3-(hydroxymethyl)-N-(2-methoxyethyl)-12-oxo-4-oxa-1,8-diazatricyclo[7.3.1.05,13]trideca-5(13),6,8,10-tetraene-11-carboxamide.
| Compound Name | 6-[(4-fluorophenyl)methyl]-10-hydroxy-3-(hydroxymethyl)-N-(2-methoxyethyl)-12-oxo-4-oxa-1,8-diazatricyclo[7.3.1.05,13]trideca-5(13),6,8,10-tetraene-11-carboxamide |
|---|---|
| PubChem CID | 54748800 |
| Molecular Formula | C22H22FN3O6 |
| Molecular Weight | 443.43 g/mol |
| Exact Mass | 443.15 |
| IUPAC Name | 6-[(4-fluorophenyl)methyl]-10-hydroxy-3-(hydroxymethyl)-N-(2-methoxyethyl)-12-oxo-4-oxa-1,8-diazatricyclo[7.3.1.05,13]trideca-5(13),6,8,10-tetraene-11-carboxamide |
| SMILES | COCCNC(=O)c1c(O)c2ncc(Cc3ccc(F)cc3)c3c2n(c1=O)CC(CO)O3 |
| InChI | InChI=1S/C22H22FN3O6/c1-31-7-6-24-21(29)16-19(28)17-18-20(32-15(11-27)10-26(18)22(16)30)13(9-25-17)8-12-2-4-14(23)5-3-12/h2-5,9,15,27-28H,6-8,10-11H2,1H3,(H,24,29) |
| InChIKey | NKQOVZTZARWVCX-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 122.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.43 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|