C23H20FN5O5 — CID 54748808
(3R)-11-N-(2-cyanoethyl)-6-[(4-fluorophenyl)methyl]-10-hydroxy-3-N-methyl-12-oxo-4-oxa-1,8-diazatricyclo[7.3.1.05,13]trideca-5(13),6,8,10-tetraene-3,11-dicarboxamide (PubChem CID 54748808) has the molecular formula C23H20FN5O5 and a molecular weight of 465.44 g/mol. Its IUPAC name is (3R)-11-N-(2-cyanoethyl)-6-[(4-fluorophenyl)methyl]-10-hydroxy-3-N-methyl-12-oxo-4-oxa-1,8-diazatricyclo[7.3.1.05,13]trideca-5(13),6,8,10-tetraene-3,11-dicarboxamide.
| Compound Name | (3R)-11-N-(2-cyanoethyl)-6-[(4-fluorophenyl)methyl]-10-hydroxy-3-N-methyl-12-oxo-4-oxa-1,8-diazatricyclo[7.3.1.05,13]trideca-5(13),6,8,10-tetraene-3,11-dicarboxamide |
|---|---|
| PubChem CID | 54748808 |
| Molecular Formula | C23H20FN5O5 |
| Molecular Weight | 465.44 g/mol |
| Exact Mass | 465.14 |
| IUPAC Name | (3R)-11-N-(2-cyanoethyl)-6-[(4-fluorophenyl)methyl]-10-hydroxy-3-N-methyl-12-oxo-4-oxa-1,8-diazatricyclo[7.3.1.05,13]trideca-5(13),6,8,10-tetraene-3,11-dicarboxamide |
| SMILES | CNC(=O)[C@H]1Cn2c(=O)c(C(=O)NCCC#N)c(O)c3ncc(Cc4ccc(F)cc4)c(c32)O1 |
| InChI | InChI=1S/C23H20FN5O5/c1-26-21(31)15-11-29-18-17(19(30)16(23(29)33)22(32)27-8-2-7-25)28-10-13(20(18)34-15)9-12-3-5-14(24)6-4-12/h3-6,10,15,30H,2,8-9,11H2,1H3,(H,26,31)(H,27,32)/t15-/m1/s1 |
| InChIKey | HNEQMSFFSBOATJ-OAHLLOKOSA-N |
| XLogP | 0.98 |
| TPSA | 146.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.44 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|